| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
N,N'-Bis(4-chlorophenyl)-N,N'-diphenyl-1,4-phenylenediamine manufacturers
|
| | N,N'-Bis(4-chlorophenyl)-N,N'-diphenyl-1,4-phenylenediamine Basic information |
| Product Name: | N,N'-Bis(4-chlorophenyl)-N,N'-diphenyl-1,4-phenylenediamine | | Synonyms: | 4',4''-DICHLORO-N,N,N',N'-TETRAPHENYL-1,4-PHENYLENEDIAMINE;Bischlorophenyldiphenylphenylenediamine;N1,N1-Bis(4-chlorophenyl)-N4,N4-diphenylbenzene-1,4-diaMine;N,N'-Bis(4-chlorophenyl)-N,N'-diphenyl-1,4-benzenediamine;1,4-Benzenediamine, N1,N4-bis(4-chlorophenyl)-N1,N4-diphenyl-;1-N,4-N-Bis(4-chlorophenyl)-1-N,4-N-diphenylbenzene-1,4-diamine;N,N'-Bis(4-chlorophenyl)-N,N'-diphenyl-1,4-phenylenediamine;N,N′-Bis(4-chlorophenyl)-N,N′-diphenyl-1,4-phenylenediamine, CAS 113703-66-5 | | CAS: | 113703-66-5 | | MF: | C30H22Cl2N2 | | MW: | 481.42 | | EINECS: | | | Product Categories: | Acid Anhydrides, etc. (Reagents for Conducting Polymer Research);Electroluminescence;Fluorenes, etc. (reagent for high-performance polymer research);Functional Materials;Reagent for High-Performance Polymer Research;Reagents for Conducting Polymer Research | | Mol File: | 113703-66-5.mol |  |
| | N,N'-Bis(4-chlorophenyl)-N,N'-diphenyl-1,4-phenylenediamine Chemical Properties |
| Melting point | 200 °C | | Boiling point | 617.3±50.0 °C(Predicted) | | density | 1.281±0.06 g/cm3(Predicted) | | pka | -2.79±0.60(Predicted) | | form | powder to crystal | | color | White to Light yellow to Green | | CAS DataBase Reference | 113703-66-5 |
| | N,N'-Bis(4-chlorophenyl)-N,N'-diphenyl-1,4-phenylenediamine Usage And Synthesis |
| Uses | N,N''-Bis(4-chlorophenyl)-N,N''-diphenyl-1,4-phenylenediamine is used as a reactant in the synthesis of heat-resistant organic electroluminescent devices. |
| | N,N'-Bis(4-chlorophenyl)-N,N'-diphenyl-1,4-phenylenediamine Preparation Products And Raw materials |
|