- DAMASCONE
-
- $34.00
-
2026-09-02
- CAS:23726-91-2
- Min. Order: 1kg
- Purity: 99%
- DAMASCONE
-
- $1.10
-
2026-08-20
- CAS:23726-91-2
- Min. Order: 1g
- Purity: 99.9%
- Supply Ability: 100 Tons Min
- β-Damascone
-
- $40.00
-
2026-07-17
- CAS:23726-91-2
- Purity: 97.50%
- Supply Ability: 10g
|
| | DAMASCONE Basic information |
| Product Name: | DAMASCONE | | Synonyms: | (e)-1-(2,6,6-trimethylcyclohex-1-enyl)-2-buten-1-one;DAMASCONE;(e)-beta-damascone;1-(2,6,6-trimethyl-1-cyclohexen-1-yl)-,(E)-2-Buten-1-one;2,6,6-trimethyl-1-trans-crotonoyl-1,3-cyclohexadiene;1-[2,6,6-Trimethyl-1-cyclohexen-1-yl]-2-buten-1-one;(E)-β-damascone,(2E)-1-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2-buten-1-one,trans-β-damascone;2-BUTEN-1-ONE, 1-(2,6,6-TRIMETHYLCYCLOHEX-1-ENYL)-, (E)- | | CAS: | 23726-91-2 | | MF: | C13H20O | | MW: | 192.3 | | EINECS: | 245-842-1 | | Product Categories: | | | Mol File: | 23726-91-2.mol |  |
| | DAMASCONE Chemical Properties |
| Boiling point | 271℃ | | density | 0.934 g/mL at 20 °C(lit.) | | vapor pressure | 2.6Pa at 25℃ | | FEMA | 3243 | 1-(2,6,6-TRIMETHYL-1-CYCLOHEXEN-1-YL)-2-BUTEN-1-ONE | | refractive index | n20/D 1.498 | | Fp | 108℃ | | storage temp. | -20°C | | solubility | Chloroform (Slightly), DMSO (Slightly) | | form | Oil | | color | Colourless to Pale Yellow | | Odor | at 1.00 % in dipropylene glycol. fruity floral berry plum blackcurrant honey rose tobacco | | Odor Type | fruity | | Water Solubility | 192.3mg/L(25 ºC) | | JECFA Number | 384 | | BRN | 2046078 | | Stability: | Light Sensitive | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C13H20O/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4/h5,7H,6,8-9H2,1-4H3/b7-5+ | | InChIKey | BGTBFNDXYDYBEY-FNORWQNLSA-N | | SMILES | C\C=C\C(=O)C1=C(C)CCCC1(C)C | | LogP | 3.68 | | EPA Substance Registry System | 2-Buten-1-one, 1-(2,6,6-trimethyl-1-cyclohexen-1-yl)-, (2E)- (23726-91-2) |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 36/37 | | WGK Germany | 2 | | RTECS | EN0340000 | | F | 10-23 | | TSCA | TSCA listed | | HS Code | 29142990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 2
Skin Irrit. 2
Skin Sens. 1B |
| | DAMASCONE Usage And Synthesis |
| Chemical Properties | Colorless to pale yellow liquid. Boiling point 52°C (0.13 Pa), relative density 0.930, refractive index 1.4957. Has a rose-like aroma. | | Uses | (E)-β-Damascone is an odorant found in some food, tea and tobacco plants. It is found to inhibit lipopolysaccharide mediated nitric oxide production through nuclear factor E2-related protein 2 signaling in human colon adenocarcinoma and mouse macrophage. | | Definition | ChEBI: 4-(2,6,6-Trimethylcyclohex-1-enyl)but-2-en-4-one is an enone. | | Synthesis Reference(s) | Journal of the American Chemical Society, 94, p. 9128, 1972 DOI: 10.1021/ja00781a023 | | Flammability and Explosibility | Non flammable |
| | DAMASCONE Preparation Products And Raw materials |
|