|
|
| | 3,4-Dimethoxybenzophenone Basic information |
| | 3,4-Dimethoxybenzophenone Chemical Properties |
| Melting point | 103-104 °C | | Boiling point | 235 °C(Press: 20 Torr) | | density | 1.123±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C15H14O3/c1-17-13-9-8-12(10-14(13)18-2)15(16)11-6-4-3-5-7-11/h3-10H,1-2H3 | | InChIKey | WCNOATOQNSHEFK-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(OC)C(OC)=C1)(C1=CC=CC=C1)=O | | CAS DataBase Reference | 4038-14-6(CAS DataBase Reference) |
| | 3,4-Dimethoxybenzophenone Usage And Synthesis |
| Uses | 3,4-Dimethoxybenzophenone serves as a precursor to prepare 3,4-dimethoxybenzophenone oxime, which can be catalytically reduced to 1-(3,4-dimethoxyphenyl)-1-phenylmethylamine[1]. | | Preparation | Obtained by reaction of benzoyl chloride with veratrole
in the presence of aluminium chloride in carbon disulfide (68%)
in the presence of zinc chloride. | | References | [1]
ITO, I., ODA, N., TAKEDA, K., WAKAYAMA, T. (1969). Synthesis of 1-(2, 3-and 3, 4-Dimethoxyphenyl)-1-phenyldimethylamine. Chemical and Pharmaceutical Bulletin, 17(7), 1524–1526. https://doi.org/10.1248/cpb.17.1524 |
| | 3,4-Dimethoxybenzophenone Preparation Products And Raw materials |
|