- 3-Acetoxyindole
-
- $1.60
-
2026-07-02
- CAS:608-08-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- INDOXYL ACETATE
-
-
2025-04-04
- CAS:608-08-2
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
- INDOXYL ACETATE
-
- $15.00
-
2021-08-12
- CAS:608-08-2
- Min. Order: 1KG
- Purity: 99%+ HPLC
|
| | INDOXYL ACETATE Basic information |
| | INDOXYL ACETATE Chemical Properties |
| Melting point | 128-130 °C(lit.) | | Boiling point | 306.47°C (rough estimate) | | density | 1.1999 (rough estimate) | | refractive index | 1.5060 (estimate) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | form | Glistening Crystals | | pka | 15.89±0.30(Predicted) | | color | Colorless to lilac | | Water Solubility | Soluble in ethanol, water, chloroform, dichloromethane and methanol. | | BRN | 143086 | | InChI | InChI=1S/C10H9NO2/c1-7(12)13-10-6-11-9-5-3-2-4-8(9)10/h2-6,11H,1H3 | | InChIKey | JBOPQACSHPPKEP-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C(OC(=O)C)=C1 | | CAS DataBase Reference | 608-08-2(CAS DataBase Reference) | | EPA Substance Registry System | 3-Indoxyl acetate (608-08-2) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | AI3325000 | | F | 8-10-21 | | TSCA | TSCA listed | | HS Code | 2933 99 80 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | INDOXYL ACETATE Usage And Synthesis |
| Chemical Properties | Dark Blue Solid | | Uses | Useful for detection of esterases3-Indoxyl acetate acts as a colorimetric substrate used for differentiating esterases from various microbiological species. Further, it is used as a plant growth-stimulating hormone and reagent. In addition to this, it acts as a useful synthetic intermediate. | | Uses | INDOXYL ACETATE is a useful synthetic intermediate. | | Definition | ChEBI: Indoxyl acetate is a member of indoles. | | Biological Activity | Indoxyl acetate (IA) can be used as a substrate to detect acetylcholinesterase (AChE) activity. It may also have the potential to be used as a suitable substrate for fast and easy detection of lipase activity. |
| | INDOXYL ACETATE Preparation Products And Raw materials |
|