- Syna-IN 510
-
- $20.00
-
2026-07-03
- CAS:15305-07-4
- Min. Order: 1g
- Purity: 0.99
- Supply Ability: 25kg
- JADEWIN 510
-
-
2026-06-02
- CAS:15305-07-4
- Min. Order: 25KG
- Purity: 98
- Supply Ability: 20
|
| | N-Nitroso-N-phenylhydroxylamine aluminum salt Basic information |
| Product Name: | N-Nitroso-N-phenylhydroxylamine aluminum salt | | Synonyms: | N-NITROSO-N-PHENYLHYDROXYLAMINE ALUMINIUM SALT;n-nitroso-n-phenylhydroxylamine aluminum salt;aluminium N-nitrosophenylhydroxyamine;8% ST + 92% 2-Phenoxyethyl Acrylate;N-nitroso-N-phenylhydroxyaMine;AluMinuM,tris[N-(hydroxy-kO)-N-(nitroso-kO)benzenaMinato]-;N-Nitorosophenylhydroxylamine alminium salt;Aluminum,tris[N-(hydroxy-κO)-N-(nitroso-κO)benzenaminato]- | | CAS: | 15305-07-4 | | MF: | C18H15AlN6O6 | | MW: | 438.34 | | EINECS: | 239-341-7 | | Product Categories: | Organometallics;john's | | Mol File: | 15305-07-4.mol |  |
| | N-Nitroso-N-phenylhydroxylamine aluminum salt Chemical Properties |
| Melting point | 167-170°C | | Boiling point | 168-170°C | | density | 1.389[at 20℃] | | vapor pressure | 0Pa at 20℃ | | storage temp. | below 5° C | | Appearance | White to off-white Solid | | Water Solubility | 280μg/L at 20℃ | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | Cosmetics Ingredients Functions | NAIL CONDITIONING | | InChI | InChI=1S/3C6H5N2O2.Al/c3*9-7-8(10)6-4-2-1-3-5-6;/h3*1-5H;/q3*-1;+3 | | InChIKey | PMSRCBOGDIMQAT-UHFFFAOYSA-N | | SMILES | [Al+3]123(O=NN(C4C=CC=CC=4)[O-]1)(O=NN(C1C=CC=CC=1)[O-]2)O=NN(C1C=CC=CC=1)[O-]3 | | CAS DataBase Reference | 15305-07-4(CAS DataBase Reference) | | EPA Substance Registry System | Aluminum, tris[N-(hydroxy-.kappa.O)-N-(nitroso-.kappa.O)benzenaminato]- (15305-07-4) |
| | N-Nitroso-N-phenylhydroxylamine aluminum salt Usage And Synthesis |
| Chemical Properties | White to pale yellow powder | | Uses | In UV-curable color paints, N-Nitroso-N-phenylhydroxylamine aluminum salt is the preferred polymerization inhibitor. It can accept small amounts of free radicals generated by free radical photoinitiators due to heat, light or other reasons, thus preventing the tendency to initiate monomer polymerization and gelation. | | Flammability and Explosibility | Not classified | | Synthesis | In the solvent mixture of alcohol and water, the pH of the reaction solution was controlled at in 5.5~5.7, and the reaction of aluminum nitrate with N-nitroso-N-phenylhydroxylamine ammonium salt, the yield of N-Nitroso-N-phenylhydroxylamine aluminum salt reached more than 91%. |
| | N-Nitroso-N-phenylhydroxylamine aluminum salt Preparation Products And Raw materials |
|