| Company Name: |
SHANGHAI ZZBIO CO., LTD.
|
| Tel: |
18019219489 18901678489 |
| Email: |
tech@zzbioco.com |
| Products Intro: |
Product Name:1-arachidonoyl-2-hydroxy -sn-glycero-3-phosphoinositol (ammonium salt)
CAS:1246430-04-5
Purity:0.99 LPI; may contain up to 10% of the 2-LPI isomer Package:100ug
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:20:4 Lyso PI
CAS:1246430-04-5
|
| Company Name: |
Creative Enzymes
|
| Tel: |
1-516-855-7709 |
| Email: |
info@creative-enzymes.com |
| Products Intro: |
Product Name:20:4 Lyso PI
CAS:1246430-04-5
|
|
| | 20:4 Lyso PI Basic information |
| Product Name: | 20:4 Lyso PI | | Synonyms: | 20:4 Lyso PI;D-myo-Inositol, 1-[(2R)-2-hydroxy-3-[[(5Z,8Z,11Z,14Z)-1-oxo-5,8,11,14-eicosatetraen-1-yl]oxy]propyl hydrogen phosphate] | | CAS: | 1246430-04-5 | | MF: | C29H49O12P | | MW: | 620.67 | | EINECS: | | | Product Categories: | | | Mol File: | 1246430-04-5.mol |  |
| | 20:4 Lyso PI Chemical Properties |
| Boiling point | 774.8±70.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | form | powder | | pka | 1.39±0.50(Predicted) | | InChIKey | QUUPQGFXDAUQSE-BIEDJLKKSA-N | | SMILES | [H][C@@](COP([O-])(O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O)=O)(O)COC(CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC)=O.[NH4+] |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 20:4 Lyso PI Usage And Synthesis |
| Uses | 1-Arachidonoyl-2-hydroxy-sn-glycero-3-phosphoinositol is used in the method of diagnosing liver disease by analyzing biological sample for biomarkers for fatty liver diseases. |
| | 20:4 Lyso PI Preparation Products And Raw materials |
|