|
|
| | 1-(3-HYDROXYPROPYL)-4-METHYLPIPERAZINE Basic information |
| Product Name: | 1-(3-HYDROXYPROPYL)-4-METHYLPIPERAZINE | | Synonyms: | 3-(4-METHYL-PIPERAZIN-1-YL)-PROPAN-1-OL;1-(3-HYDROXYPROPYL)-4-METHYLPIPERAZINE;N-METHYL-N'-(3 HYDROXYLPROPYL) PIPERAZINE;3-(4-methyl-1-piperazine)propan-1-ol;1-Piperazinepropanol,4-methyl-(6CI,7CI,8CI,9CI);1-(3-HYDROXYPROPYL)-4-METHYL-PIPERAZINE >98%;3-(4-Methylpiperazin-1-yl)-1-propanol;4-Methyl-1-piperazine-1-propanol | | CAS: | 5317-33-9 | | MF: | C8H18N2O | | MW: | 158.24 | | EINECS: | 226-177-6 | | Product Categories: | pharmacetical;piperazines;PIPERIDINE | | Mol File: | 5317-33-9.mol |  |
| | 1-(3-HYDROXYPROPYL)-4-METHYLPIPERAZINE Chemical Properties |
| Melting point | 30 °C | | Boiling point | 75-78°C/0.5mm | | density | 0.988±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly) | | form | Solid | | pka | 15.10±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C8H18N2O/c1-9-4-6-10(7-5-9)3-2-8-11/h11H,2-8H2,1H3 | | InChIKey | IIXZEUJZLXHPLB-UHFFFAOYSA-N | | SMILES | N1(CCCO)CCN(C)CC1 | | CAS DataBase Reference | 5317-33-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 24/25-26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933599590 |
| | 1-(3-HYDROXYPROPYL)-4-METHYLPIPERAZINE Usage And Synthesis |
| Uses | 4-Methyl-1-piperazinepropanol is a useful synthetic organic compound used in the synthesis of S-Alkyl-N-alkylisothiourea compounds. | | Synthesis | General procedure for the synthesis of 1-(3-hydroxypropyl)-4-methylpiperazine from N-methylpiperazine and 3-bromo-1-propanol: Intermediate 7: 3-(4-methylpiperazin-1-yl)-propan-1-ol. Dissolve N-methylpiperazine (6.99 mL, 63 mmol) in toluene (30 mL). 3-Bromo-1-propanol (2.62 mL, 30 mmol) was added slowly and the reaction mixture was stirred at room temperature overnight. Subsequently, the reaction mixture was heated to 80 °C and kept for 2 h, and then cooled to room temperature. The reaction mixture was filtered and the filter cake was washed thoroughly with toluene. After removal of toluene under reduced pressure, the residue was subjected to Kugelrohr distillation (boiling point: 180 °C/2 mbar) to give a colorless oily product (4.08 g, 25.8 mmol, 86% yield). 1H NMR (CDCl3): δ= 1.70 (pseudo quintuple peak, J = 5.8 Hz, 2H), 2.26 (s, 3H), 2.35-2.60 (m, 8H), 2.60 (pseudo triple peak, J = 5.8 Hz, 2H), 3.77 (pseudo triple peak, J = 5.3 Hz, 2H), 4.09 (broad single peak, 1H). | | References | [1] Patent: EP1674467, 2006, A1. Location in patent: Page/Page column 26
[2] Patent: EP1674466, 2006, A1. Location in patent: Page/Page column 27
[3] Patent: US2006/142570, 2006, A1. Location in patent: Page/Page column 17
[4] Patent: US2006/135782, 2006, A1. Location in patent: Page/Page column 26
[5] Patent: EP1746096, 2007, A1. Location in patent: Page/Page column 25 |
| | 1-(3-HYDROXYPROPYL)-4-METHYLPIPERAZINE Preparation Products And Raw materials |
|