|
|
| | 1-(PHENYLSULFONYL)INDOLE Basic information |
| | 1-(PHENYLSULFONYL)INDOLE Chemical Properties |
| Melting point | 78-80 °C(lit.) | | Boiling point | 192°C 3mm | | density | 1.26±0.1 g/cm3(Predicted) | | Fp | 192°C/3mm | | storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | BRN | 1286712 | | InChI | InChI=1S/C14H11NO2S/c16-18(17,13-7-2-1-3-8-13)15-11-10-12-6-4-5-9-14(12)15/h1-11H | | InChIKey | VDWLCYCWLIKWBV-UHFFFAOYSA-N | | SMILES | N1(S(C2=CC=CC=C2)(=O)=O)C2=C(C=CC=C2)C=C1 | | CAS DataBase Reference | 40899-71-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-37/39-26 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | 1-(PHENYLSULFONYL)INDOLE Usage And Synthesis |
| Chemical Properties | Off-white to pink crystalline powder | | Uses | Reactant for preparation of:
- Antiplasmodial agents
- Antifungal agents
- Anti HIV-1 agents
- Agonists of the histamine H4 receptor
- Antibacterial agents
- Camalexin analogs
- CDK inhibitors and cytotoxic agents
- Histone Deacetylase inhibitors
| | Definition | ChEBI: 1-(benzenesulfonyl)indole is a sulfonamide. | | Synthesis Reference(s) | Synthesis, p. 136, 1979
Tetrahedron Letters, 29, p. 2151, 1988 DOI: 10.1016/S0040-4039(00)86696-4 |
| | 1-(PHENYLSULFONYL)INDOLE Preparation Products And Raw materials |
|