|
|
| | Guanidine-d5 Hydrochloride Basic information |
| | Guanidine-d5 Hydrochloride Chemical Properties |
| Melting point | 185-189 °C(lit.) | | storage temp. | Hygroscopic, Refrigerator, Under inert atmosphere | | solubility | DMSO (Sparingly) | | form | Solid | | color | White to Off-White | | InChI | 1S/CH5N3.ClH/c2-1(3)4;/h(H5,2,3,4);1H/i/hD6 | | InChIKey | PJJJBBJSCAKJQF-YIKVAAQNSA-N | | SMILES | Cl[2H].[2H]\N=C(/N([2H])[2H])N([2H])[2H] | | CAS Number Unlabeled | 50-01-1 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2 |
| | Guanidine-d5 Hydrochloride Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Guanidine-d5 Hydrochloride has a good bacterial and fungicidal efficacy when used in low concentration and can also be used as disinfectant. | | Uses | Isotope labelled Guanidine (G821245) has a good bacterial and fungicidal efficacy when used in low concentration and can also be used as disinfectant. |
| | Guanidine-d5 Hydrochloride Preparation Products And Raw materials |
|