| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Xylenol Orange sodium salt Basic information | | Preparation |
| Product Name: | Xylenol Orange sodium salt | | Synonyms: | O-CRESOLSULFONPHTHALEINDI-(METHYL-IMINODIACETIC ACID) SODIUM SALT;XYLENOL ORANGE SODIUM SALT;XYLENOL ORANGE, WATER SOLUBLE;XYLENOL ORANGE TETRASODIUM;Xylenol Orange sodium salt, 0.1% w/v aq. soln.;o-Cresolsulfonphthalein-3μ-3-bis(methyliminodiacetic acid sodium salt);Two cresol orange indicator;e sodiuM saL | | CAS: | 63721-83-5 | | MF: | C31H31N2NaO13S | | MW: | 694.64 | | EINECS: | 216-553-8 | | Product Categories: | | | Mol File: | 63721-83-5.mol |  |
| | Xylenol Orange sodium salt Chemical Properties |
| Melting point | 195 °C (dec.)(lit.) | | pka | pK2:2.58(-1);pK3:3.23(-2);pK4:6.37(-3);pK5: 10.46(-4);pK6: 12.28(-5) (25°C) | | InChIKey | VFKMJZUEFSTCGQ-PXNGTKLSSA-M | | SMILES | C(=C1/C=C(C(=O)C(CN(CC(=O)O)CC(=O)O)=C/1)C)(\C1=CC(=C(O)C(CN(CC(=O)O)CC(=O)O)=C1)C)/C1C=CC=CC=1S([O-])(=O)=O.[Na+] | | CAS DataBase Reference | 63721-83-5 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2914.50.3000 |
| | Xylenol Orange sodium salt Usage And Synthesis |
| Preparation | Xylenol Orange sodium salt is prepared by the Mannich condensation reaction of sodium iminodiacetic acid, cresol red (o-cresol sulfonylphthalein) and formaldehyde, and then acidified with hydrochloric acid. | | Uses | Xylenol Orange is used in method for detecting main content of tungsten oxide. |
| | Xylenol Orange sodium salt Preparation Products And Raw materials |
|