| Company Name: |
Jinan Jingyuan Biotechnology Co., Ltd Gold
|
| Tel: |
18678301331 18678301331; |
| Email: |
6455466@qq.com |
| Products Intro: |
Product Name:2-Methoxyxanthone
CAS:1214-20-6
Purity:98% Package:10g;50g;100g;1kg
|
| Company Name: |
Amatek Scientific Co. Ltd.
|
| Tel: |
0512-56316828 |
| Email: |
info@amateksci.com |
| Products Intro: |
Product Name:9H-Xanthen-9-one, 2-methoxy
CAS:1214-20-6
Purity:97% HPLC Package:5g;25g;100g;1kg
|
|
| | 2-Methoxy-9H-xanthen-9-one Basic information |
| | 2-Methoxy-9H-xanthen-9-one Chemical Properties |
| Melting point | 131 °C | | Boiling point | 388.2±31.0 °C(Predicted) | | density | 1.273±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C14H10O3/c1-16-9-6-7-13-11(8-9)14(15)10-4-2-3-5-12(10)17-13/h2-8H,1H3 | | InChIKey | DVZCOQQFPCMIPO-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)OC2=C1C=C(OC)C=C2 |
| Hazard Codes | Xn | | Risk Statements | 22 |
| | 2-Methoxy-9H-xanthen-9-one Usage And Synthesis |
| Definition | ChEBI: 2-Methoxyxanthone is a member of xanthones. |
| | 2-Methoxy-9H-xanthen-9-one Preparation Products And Raw materials |
|