4-Methylumbelliferyl butyrate manufacturers
|
| | 4-Methylumbelliferyl butyrate Basic information |
| Product Name: | 4-Methylumbelliferyl butyrate | | Synonyms: | 4-methyl-2-oxo-2H-1-benzopyran-7-yl butyrate;4-METHYLUMBELLIFERYL BUTYRATE, FOR FLUOR ESCENCE;forfluorescence,95+%;mu-bu;4-METHYLUMBELLIFERYL BUTYRATE FOR FLUORESCENCE 95+%;Butyric acid 2-oxo-4-methyl-2H-1-benzopyran-7-yl ester;Butyric acid 4-methyl-2-oxo-2H-1-benzopyran-7-yl ester;METHYLUMBELLIFERYL BUTYRATE, 4- | | CAS: | 17695-46-4 | | MF: | C14H14O4 | | MW: | 246.26 | | EINECS: | 241-694-7 | | Product Categories: | Substrates | | Mol File: | 17695-46-4.mol |  |
| | 4-Methylumbelliferyl butyrate Chemical Properties |
| Melting point | 90-92 °C(lit.) | | Boiling point | 393.4±37.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: soluble | | form | Solid | | color | White | | BRN | 227973 | | InChI | 1S/C14H14O4/c1-3-4-13(15)17-10-5-6-11-9(2)7-14(16)18-12(11)8-10/h5-8H,3-4H2,1-2H3 | | InChIKey | WKPUJZVCZXWKCK-UHFFFAOYSA-N | | SMILES | CCCC(=O)Oc1ccc2C(C)=CC(=O)Oc2c1 | | EPA Substance Registry System | Butanoic acid, 4-methyl-2-oxo-2H-1-benzopyran-7-yl ester (17695-46-4) |
| Hazard Codes | T+ | | Risk Statements | 26/27/28 | | Safety Statements | 24/25 | | WGK Germany | 3 | | F | 8-10-21 | | TSCA | TSCA listed | | HS Code | 29322090 | | Storage Class | 11 - Combustible Solids |
| | 4-Methylumbelliferyl butyrate Usage And Synthesis |
| Uses | Fluorogenic substrate for butyrate esterase. | | Uses | 4-Methylumbelliferyl Butyrate is suitable to use as a fluorogenic substrate for esterases/lipases, such as butyrate esterase. | | Definition | ChEBI: A member of the class of coumarins that is 4-methylumbelliferone in which the hydroxyl hydrogen is replaced by a butyryl group. |
| | 4-Methylumbelliferyl butyrate Preparation Products And Raw materials |
|