| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
N-Cyano-N'-methyl-ethanimidamide manufacturers
|
| | N-Cyano-N'-methyl-ethanimidamide Basic information |
| Product Name: | N-Cyano-N'-methyl-ethanimidamide | | Synonyms: | N-Cyano-N'-Methyl Acetamidine;N-Methyl-N'-cyanoacetaMidine;-methyl-ethanimidamide;-3-pyridinyl-guanidine;S-dimethylisothiourea;Ethanimidamide, N-cyano-N'-methyl-;N-cyano-N-methylacetimidamide;N-Cyano-N'-methyl-ethanimidamide | | CAS: | 56563-12-3 | | MF: | C4H7N3 | | MW: | 97.12 | | EINECS: | | | Product Categories: | | | Mol File: | 56563-12-3.mol |  |
| | N-Cyano-N'-methyl-ethanimidamide Chemical Properties |
| Boiling point | 132.624±23.00 °C(Press: 760.00 Torr)(predicted) | | density | 0.963±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 0.693±0.50(predicted) | | InChI | InChI=1S/C4H7N3/c1-4(6-2)7-3-5/h1-2H3,(H,6,7) | | InChIKey | HGUZMABFJZHYJY-UHFFFAOYSA-N | | SMILES | C(NC#N)(=NC)C | | CAS DataBase Reference | 56563-12-3 |
| | N-Cyano-N'-methyl-ethanimidamide Usage And Synthesis |
| Chemical Properties | This product is white powder, mp97.2～100.4℃, insoluble in water. | | Uses | N-cyano-N'-methylacetamidine is an intermediate for the insecticide acetamiprid. | | Synthesis | The preparation method takes acetonitrile and methanol as raw materials, feeds dry hydrogen chloride to obtain methyl acetimidate, then reacts with cyanamide to generate N-cyanomethyl acetimidate, and finally reacts with methylamine to generate N-cyanide. base-N'-methylacetamidine. |
| | N-Cyano-N'-methyl-ethanimidamide Preparation Products And Raw materials |
|