| Company Name: |
Shanghai Daken Advanced Materials Co.,Ltd |
| Tel: |
+86-2158073036 |
| Email: |
info@dakenam.com |
| Products Intro: |
Product Name:Propane,1,1,1,2,3,3-hexafluoro-3-(2,2,2-trifluoroethoxy)- CAS:993-95-3 Purity:99% Package:1KG,5KG,10KG
|
|
|
|
|
1,1,2,3,3,3-HEXAFLUOROPROPYL 2,2,2-TRIFLUOROETHYL ETHER manufacturers
|
| | 1,1,2,3,3,3-HEXAFLUOROPROPYL 2,2,2-TRIFLUOROETHYL ETHER Basic information |
| Product Name: | 1,1,2,3,3,3-HEXAFLUOROPROPYL 2,2,2-TRIFLUOROETHYL ETHER | | Synonyms: | 1,1,1,4,4,5,6,6,6-NONAFLUORO-3-OXAHEXANE;1,1,2,3,3,3-HEXAFLUOROPROPYL 2,2,2-TRIFLUOROETHYL ETHER;1,1,2,3,3,3-Hexafluoropropyl2,2,2-trifluoroethylether97%;Propane,1,1,1,2,3,3-hexafluoro-3-(2,2,2-trifluoroethoxy)-;1,1,1,2,3,3-hexafluoro-3-(2,2,2-trifluoroethoxy)propane;CF3CFHCF2OCH2CF3;HFE-449;1,1,2,3,3,3-Hexafluoropropyl 2,2,2-trifluoroethyl ether(HFE-449) | | CAS: | 993-95-3 | | MF: | C5H3F9O | | MW: | 250.06 | | EINECS: | | | Product Categories: | | | Mol File: | 993-95-3.mol |  |
| | 1,1,2,3,3,3-HEXAFLUOROPROPYL 2,2,2-TRIFLUOROETHYL ETHER Chemical Properties |
| Boiling point | 72 °C(Press: 750 Torr) | | density | 1.5398 g/cm3 | | form | oil | | color | Colourless | | InChI | InChI=1S/C5H3F9O/c6-2(4(10,11)12)5(13,14)15-1-3(7,8)9/h2H,1H2 | | InChIKey | LMRGTZDDPWGCGL-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)C(F)C(F)(F)OCC(F)(F)F | | EPA Substance Registry System | Propane, 1,1,1,2,3,3-hexafluoro-3-(2,2,2-trifluoroethoxy)- (993-95-3) |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2909199090 |
| | 1,1,2,3,3,3-HEXAFLUOROPROPYL 2,2,2-TRIFLUOROETHYL ETHER Usage And Synthesis |
| | 1,1,2,3,3,3-HEXAFLUOROPROPYL 2,2,2-TRIFLUOROETHYL ETHER Preparation Products And Raw materials |
|