(25R)-Spirost-4-en-3,12-dion manufacturers
|
| | (25R)-Spirost-4-en-3,12-dion Basic information |
| Product Name: | (25R)-Spirost-4-en-3,12-dion | | Synonyms: | (25R)-Spirost-4-en-3,12-dion;Spirost-4-ene-3,12-dione, (25R)-;25R-spirost-4-ene-3,12-dione;25D-Spirost-4-ene-3,12-dione;(-)-(25R)-Spirost-4-ene-3,12-dione;natural product,neutrophil,mast cells,histamine,Inhibitor,(25R)Spirost4ene3,12dione,inhibit,(25R) Spirost 4 ene 3,12 dione;(25R)-Spirost-4-ene-3,12-dione-(25R)-Spirost-4-ene-3,12-dione;(25R)-Spirost-4-ene-3,12-dione - [S88757] | | CAS: | 6875-60-1 | | MF: | C27H38O4 | | MW: | 426.59 | | EINECS: | | | Product Categories: | | | Mol File: | 6875-60-1.mol |  |
| | (25R)-Spirost-4-en-3,12-dion Chemical Properties |
| form | Solid | | color | White to off-white | | InChIKey | ZVWYBBDTSJOAHD-HGMFYQPQSA-N | | SMILES | C1(=O)C=C2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](C(=O)C1)(C)[C@]1([C@H](C)[C@@]4(CC[C@@H](C)CO4)O[C@@]1([H])C3)[H])CC2 |
| | (25R)-Spirost-4-en-3,12-dion Usage And Synthesis |
| Uses | (25R)-Spirost-4-ene-3,12-dione ((-)-(25R)-Spirost-4-ene-3,12-dione) is a natural product that has an inhibitory effect on neutrophil superoxide anion production and histamine release from mast cells[1]. | | References | [1] P L Tsai, et al. Constituents and bioactive principles of Polygonum chinensis. Phytochemistry. 1998 Nov;49(6):1663-6. DOI:10.1016/s0031-9422(98)00322-7 |
| | (25R)-Spirost-4-en-3,12-dion Preparation Products And Raw materials |
|