2-(3,6-Dimethoxycarbazol-9-yl)ethylphosphonic acid manufacturers
|
| | 2-(3,6-Dimethoxycarbazol-9-yl)ethylphosphonic acid Basic information | | Application |
| | 2-(3,6-Dimethoxycarbazol-9-yl)ethylphosphonic acid Chemical Properties |
| Boiling point | 538.9±60.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | pka | 2.38±0.10(Predicted) | | form | solid | | InChI | InChI=1S/C16H18NO5P/c1-21-11-3-5-15-13(9-11)14-10-12(22-2)4-6-16(14)17(15)7-8-23(18,19)20/h3-6,9-10H,7-8H2,1-2H3,(H2,18,19,20) | | InChIKey | XIOYECJFQJFYLM-UHFFFAOYSA-N | | SMILES | P(CCN1C2=C(C=C(OC)C=C2)C2=C1C=CC(OC)=C2)(=O)(O)O |
| | 2-(3,6-Dimethoxycarbazol-9-yl)ethylphosphonic acid Usage And Synthesis |
| Application | (2-(3,6-Dimethoxy-9H-carbazole-9-yl)ethyl)phosphonic acid is an organophosphonic ligand mainly used in chemical experimental research and development processes. | | Uses | Phosphonic acid derivative with organic semiconductor properies due to presence of carbazole moiety. This structure can facilitate charge transport, making it a candidate for applications in organic semiconductor, such as in organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs). This derivative has demonstrated a significant improvement in power conversion efficiency (PCE) in perovskite-silicon tandem solar cells, achieving a PCE of 23.26% |
| | 2-(3,6-Dimethoxycarbazol-9-yl)ethylphosphonic acid Preparation Products And Raw materials |
|