|
|
| Product Name: | 2PACz | | Synonyms: | Phosphonic acid, (2-carbazol-9-ylethyl)- (8CI);2PACz;Phosphonic acid, P-[2-(9H-carbazol-9-yl)ethyl]-;(2-(9H-carbazol-9-yl)ethyl)phosphonic aci;2PACz, (2-(9H-carbazol-9-yl)ethyl)phosphonic acid;(2-(9H-carbazol-9-yl)ethyl);(2-Carbazol-9-ylethyl)-phosphonic acid;2PACz,≥98% | | CAS: | 20999-38-6 | | MF: | C14H14NO3P | | MW: | 275.24 | | EINECS: | | | Product Categories: | | | Mol File: | 20999-38-6.mol |  |
| | 2PACz Chemical Properties |
| Melting point | 230-231 °C | | Boiling point | 478.6±51.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, sealed storage, away from moisture | | pka | 1.98±0.10(Predicted) | | form | powder to crystaline | | color | White to Blue | | InChI | InChI=1S/C14H14NO3P/c16-19(17,18)10-9-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8H,9-10H2,(H2,16,17,18) | | InChIKey | KIMPAVBWSFLENS-UHFFFAOYSA-N | | SMILES | P(CCN1C2=C(C=CC=C2)C2=C1C=CC=C2)(=O)(O)O |
| | 2PACz Usage And Synthesis |
| Description |
2PACz, also known as (2-(9H-carbazol-9-yl)ethyl)phosphonic acid, consists of an electron-rich carbazole body with an ethyl phosphonic acid anchoring group. 2PACz as a hole-selective interlayer functionalized directly onto the indium tin oxide (ITO) anode. The 2PACz is found to change the work function of ITO while simultaneously affecting the morphology of the bulk-heterojunction deposited atop.
|
| | 2PACz Preparation Products And Raw materials |
|