| Company Name: |
HANGZHOU LAURET BIOTECHOLOGY CO.,LTD Gold
|
| Tel: |
15306536782 |
| Email: |
3839324846@qq.com |
| Products Intro: |
Product Name:(S,R,S)-AHPC-PEG4-acid CAS:2172820-12-9 Purity:98% Package:1g/RMB 4000
|
| Company Name: |
SuZhou Medinoah Co.,LTD.
|
| Tel: |
0512-69561983 13914027025 |
| Email: |
zhang_q@medinoah.com |
| Products Intro: |
Product Name:(S,R.S)-AHPC-PEG4-acid CAS:2172820-12-9 Purity:>95% Package:5g;10g;1kg;10kg;>10kg 大货
|
|
| | (S,R.S)-AHPC-PEG4-acid Basic information |
| Product Name: | (S,R.S)-AHPC-PEG4-acid | | Synonyms: | (S,R.S)-AHPC-PEG4-acid;(S)-18-((2S,4R)-4-Hydroxy-2-((4-(4-methylthiazol-5-yl)benzyl)carbamoyl)pyrrolidine-1-carbonyl)-19,19-dimethyl-16-oxo-4,7,10,13-tetraoxa-17-azaicosan-1-oic acid;L-Prolinamide, N-(15-carboxy-1-oxo-4,7,10,13-tetraoxapentadec-1-yl)-3-methyl-L-valyl-4-hydroxy-N-[[4-(4-methyl-5-thiazolyl)phenyl]methyl]-, (4R)-;1-{[(2S)-1-[(2S,4R)-4-hydroxy-2-({[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl}carbamoyl)pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl}-3,6,9,12-tetraoxapentadecan-15-oic acid;VH 032 amide-PEG4-acid;(S,R,S)-AHPC-CO-PEG4-C2-acid;(S)-18-((2S,4R)-4-hydroxy-2-((4-(4-methylthiazol-5-yl)benzyl)carbamoyl)pyrrolidine-1-carbonyl)-19,19-dimethyl-16-oxo-4,7,10,13-tetraoxa-17-azaicosanoic acid | | CAS: | 2172820-12-9 | | MF: | C34H50N4O10S | | MW: | 706.85 | | EINECS: | | | Product Categories: | | | Mol File: | 2172820-12-9.mol |  |
| | (S,R.S)-AHPC-PEG4-acid Chemical Properties |
| Boiling point | 950.9±65.0 °C(Predicted) | | density | 1.254±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Water, DMSO | | pka | 4.28±0.10(Predicted) | | form | powder or crystals | | color | White to Beige | | InChIKey | WCMFOLDVYYDUGD-FMVCKAMOSA-N | | SMILES | C([C@@H](NC(CCOCCOCCOCCOCCC(O)=O)=O)[C@](C)(C)C)(=O)N1[C@H](C(NCC2=CC=C(C=C2)C3=C(C)N=CS3)=O)C[C@@H](O)C1 |
| WGK Germany | WGK 3 | | HS Code | 2934100090 | | Storage Class | 11 - Combustible Solids |
| | (S,R.S)-AHPC-PEG4-acid Usage And Synthesis |
| Description | (S, R, S)-AHPC-PEG4-acid is a synthetic PROTAC linker that incorporates an E3 ligase ligand with a PEG4 arm to empower PROTAC drug research & discovery. It is reactive with amine containing molecule. The hydrophilic PEG spacer increases the solubility of a compound in aqueous media. | | Uses | (S,R,S)-AHPC-PEG4-acid is a synthetic PROTAC ligand that binds the E3 ligase ligand to the PEG4 arm, thereby enhancing PROTAC drug research and discovery[1]. | | storage | Store at -20°C | | References | [1] Jian Jin, et al. Compositions and methods for treating ezh2-mediated cancer. WO2018081530A1.2018-05-03. |
| | (S,R.S)-AHPC-PEG4-acid Preparation Products And Raw materials |
|