L-Valine, 3-methyl-N-(trifluoroacetyl)- (9CI) manufacturers
- Paxlovid intermediate
-
- $1.50
-
2026-05-15
- CAS:666832-71-9
- Min. Order: 1g
- Purity: 99.0% Min
- Supply Ability: 100 Tons
|
| | L-Valine, 3-methyl-N-(trifluoroacetyl)- (9CI) Basic information |
| Product Name: | L-Valine, 3-methyl-N-(trifluoroacetyl)- (9CI) | | Synonyms: | L-Valine, 3-methyl-N-(trifluoroacetyl)- (9CI);Trifluoroacetyl L-Tert-Leucine;PF-07321332-003;Paxlovid Impurity 3;666832-71-9;PF-07321332 Impurity 80;(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid;2- Methyl - N -( trifluoroacetyl )- L - Valine | | CAS: | 666832-71-9 | | MF: | C8H12F3NO3 | | MW: | 227.18 | | EINECS: | 674-976-7 | | Product Categories: | 666832-71-9 | | Mol File: | 666832-71-9.mol |  |
| | L-Valine, 3-methyl-N-(trifluoroacetyl)- (9CI) Chemical Properties |
| Boiling point | 308.1±42.0 °C(Predicted) | | density | 1.276±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 3.08±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H12F3NO3/c1-7(2,3)4(5(13)14)12-6(15)8(9,10)11/h4H,1-3H3,(H,12,15)(H,13,14)/t4-/m1/s1 | | InChIKey | FCTPLAZWXGEGKO-SCSAIBSYSA-N | | SMILES | C(O)(=O)[C@H](C(C)(C)C)NC(C(F)(F)F)=O |
| | L-Valine, 3-methyl-N-(trifluoroacetyl)- (9CI) Usage And Synthesis |
| Uses | L-Valine, 3-methyl-N-(trifluoroacetyl)- (9CI) is a pharmaceutical intermediate composition for the preparation of nitrile-containing antiviral compounds. | | Application | L-Valine, 3-methyl-N-(trifluoroacetyl)- (9CI) is a key pharmaceutical intermediate for the anti-COVID-19 drug nirmatrelvir (trade name Paxlovid). Nirmatrelvir is an oral SARS-CoV-2 main protease (Mpro) inhibitor that, when used in combination with ritonavir (i.e., Paxlovid), can effectively inhibit the replication of the SARS-CoV-2 virus and is used to treat patients with mild to moderate COVID-19. |
| | L-Valine, 3-methyl-N-(trifluoroacetyl)- (9CI) Preparation Products And Raw materials |
|