|
|
| | 2-Azido-2-deoxy-D-glucose Basic information |
| Product Name: | 2-Azido-2-deoxy-D-glucose | | Synonyms: | 2-Azido-2-deoxy-D-glucose >=98.0% (HPLC);2-Azido-2-deoxy-D-glucose;(2R,3R,4S,5R)-2-azido-3,4,5,6-tetrahydroxyhexanal;2-Azide-2-deoxy-D-glucose;2-Azido-2-deoxy-D-glucose USP/EP/BP;D-Glucose, 2-azido-2-deoxy-;2-azido-2-deoxy-β-D-glucose;2-Azido-2-deoxy-D-glucose | | CAS: | 56883-39-7 | | MF: | C6H11N3O5 | | MW: | 205.17 | | EINECS: | 635-821-9 | | Product Categories: | | | Mol File: | 56883-39-7.mol |  |
| | 2-Azido-2-deoxy-D-glucose Chemical Properties |
| Melting point | >149oC (dec.) | | storage temp. | 2-8°C | | solubility | Acetonitrile (Slightly), Water (Slightly) | | form | Solid | | pka | 12.747±0.20(predicted) | | color | White | | Optical Rotation | [α]/D 22.5±1.0°, c = 1 in H2O | | BRN | 2216646 | | InChI | InChI=1/C6H11N3O5/c7-9-8-3-5(12)4(11)2(1-10)14-6(3)13/h2-6,10-13H,1H2/t2-,3-,4-,5-,6/s3 | | InChIKey | URARQBMUQIRZQO-QZGCUHCDSA-N | | SMILES | [C@H]1(N=[N+]=[N-])C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |&1:0,7,10,12,r| |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36/37 | | WGK Germany | 3 | | HS Code | 29329990 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| | 2-Azido-2-deoxy-D-glucose Usage And Synthesis |
| Uses | 2-Azido-2-deoxy-D-glucose is a glucose derivative that have been used to study the substrate specificity of galactokinase. | | reaction suitability | reaction type: click chemistry |
| | 2-Azido-2-deoxy-D-glucose Preparation Products And Raw materials |
|