- Drometrizole Trisiloxane
-
- $0.00 / 1KG
-
2026-05-19
- CAS:155633-54-8
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
|
| | DROMETRIZOLE TRISILOXANE Basic information |
| Product Name: | DROMETRIZOLE TRISILOXANE | | Synonyms: | DROMETRIZOLE TRISILOXANE;Drometrizole Trisiloxane (200 mg);DroMetrizde trisiloxane;2-(2H-Benzotriazol-2-yl)-4-methyl-6-{2-methyl-3-{1,3,3,3-tetramethyl-1-[(trimethylsilyl)oxy]disiloxanyl}propyl}phenol;Silatrizole;Cresol triazole trisiloxane;Phenol, 2-(2H-benzotriazol-2-yl)-4-methyl-6-[2-methyl-3-[1,3,3,3-tetramethyl-1-[(trimethylsilyl)oxy]-1-disiloxanyl]propyl]-;Ecamsule/Mexoryl XL | | CAS: | 155633-54-8 | | MF: | C24H39N3O3Si3 | | MW: | 501.84 | | EINECS: | 422-940-4 | | Product Categories: | | | Mol File: | 155633-54-8.mol |  |
| | DROMETRIZOLE TRISILOXANE Chemical Properties |
| Melting point | 46-48°C | | Boiling point | 530.6±60.0 °C(Predicted) | | density | 1.06±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 8.36±0.50(Predicted) | | form | Solid | | color | Pale Beige | | BRN | 11343300 | | Major Application | cleaning products cosmetics environmental food and beverages personal care | | Cosmetics Ingredients Functions | LIGHT STABILIZER UV FILTER UV ABSORBER | | InChI | InChI=1S/C24H39N3O3Si3/c1-18-14-20(15-19(2)17-33(9,29-31(3,4)5)30-32(6,7)8)24(28)23(16-18)27-25-21-12-10-11-13-22(21)26-27/h10-14,16,19,28H,15,17H2,1-9H3 | | InChIKey | HUVYTMDMDZRHBN-UHFFFAOYSA-N | | SMILES | OC1C(=CC(C)=CC=1N1N=C2C=CC=CC2=N1)CC(C)C[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C | | CAS DataBase Reference | 155633-54-8 |
| WGK Germany | 1 | | HS Code | 2933997500 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 4 |
| | DROMETRIZOLE TRISILOXANE Usage And Synthesis |
| Uses | drometrizole trisiloxane is a uV absorber/uV filter, it provides uVBand some uVA-spectrum protection. | | Uses | Drometrizole Trisiloxane is used in the synthesis of UV light absorbers and filters for polyester fibers and suncare formulations. |
| | DROMETRIZOLE TRISILOXANE Preparation Products And Raw materials |
|