| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (6R,2S)-Diaminopimelic acid Basic information |
| Product Name: | (6R,2S)-Diaminopimelic acid | | Synonyms: | (6R,2S)-Diaminopimelic acid;2R,6S-DIAMINO-HEPTANEDIOIC ACID;(2SR, 6RS)-2,6-Diaminoheptanedioic acid;meso-2,6-Diaminopimelic acid;meso-DAP;Heptanedioic acid, 2,6-diamino-, (2R,6S)-rel-;meso-2,6-Diaminopimelic acid >=98% (TLC);(2R,6S)-rel-2,6-Diaminoheptanedioic acid | | CAS: | 922-54-3 | | MF: | C7H14N2O4 | | MW: | 190.2 | | EINECS: | | | Product Categories: | | | Mol File: | 922-54-3.mol |  |
| | (6R,2S)-Diaminopimelic acid Chemical Properties |
| Melting point | 340-342 °C (decomp) | | Boiling point | 426.7±45.0 °C(Predicted) | | density | 1.344±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder | | pka | 2.20±0.24(Predicted) | | color | white to faint beige | | BRN | 1726899 | | Major Application | cell analysis | | InChI | 1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5+ | | InChIKey | GMKMEZVLHJARHF-SYDPRGILSA-N | | SMILES | N[C@H](CCC[C@H](N)C(O)=O)C(O)=O || N[C@H](CCC[C@H](N)C(O)=O)C(O)=O |
| WGK Germany | 3 | | HS Code | 2922500090 | | Storage Class | 11 - Combustible Solids |
| | (6R,2S)-Diaminopimelic acid Usage And Synthesis |
| Uses | Meso-2,6-diaminopimelic acid may be used to study peptidoglycan structure and function within the cell walls of bacteria. | | Definition | ChEBI: Meso-2,6-diaminopimelic acid is the meso-isomer of 2,6-diaminopimelic acid. It is a key constituent of bacterial peptidoglycan and is often found in human urine due to the breakdown of the gut microbes. It has a role as a human metabolite. It is a conjugate acid of a meso-2,6-diaminopimelate(2-). It is a tautomer of a meso-2,6-diaminopimelic acid dizwitterion. | | Biochem/physiol Actions | Penultimate biosynthetic precursor of the essential amino acid L-lysine. Component of peptidoglycan in the cell wall of many bacteria. |
| | (6R,2S)-Diaminopimelic acid Preparation Products And Raw materials |
|