| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | N-Boc-1-amino-1-cyclopentanemethanol Basic information |
| | N-Boc-1-amino-1-cyclopentanemethanol Chemical Properties |
| Melting point | 108-112 °C | | Boiling point | 274.9±7.0 °C(Predicted) | | density | 0.97±0.1 g/cm3(Predicted) | | pka | 12.91±0.20(Predicted) | | form | solid | | InChI | 1S/C11H21NO3/c1-10(2,3)15-9(14)12-11(8-13)6-4-5-7-11/h13H,4-8H2,1-3H3,(H,12,14) | | InChIKey | KORMKULLVQEUDG-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)NC1(CO)CCCC1 |
| Hazard Codes | Xi,N | | Risk Statements | 36/37/38-50 | | Safety Statements | 26-36-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | N-Boc-1-amino-1-cyclopentanemethanol Usage And Synthesis |
| | N-Boc-1-amino-1-cyclopentanemethanol Preparation Products And Raw materials |
|