4-Chloro-3,5-difluoro-phenylamine manufacturers
|
| | 4-Chloro-3,5-difluoro-phenylamine Basic information |
| Product Name: | 4-Chloro-3,5-difluoro-phenylamine | | Synonyms: | Benzenamine, 4-chloro-3,5-difluoro-;4-CHLORO-3,5-DIFLUORO-PHENYLAMINE ISO 9001：2015 REACH;4-chloro-3,5-difluorobenzenamine;4-Chloro-3,5-difluoroaniline;4-Chloro-3,5-difluoro-phenylamine | | CAS: | 2613-33-4 | | MF: | C6H4ClF2N | | MW: | 163.55 | | EINECS: | | | Product Categories: | | | Mol File: | 2613-33-4.mol |  |
| | 4-Chloro-3,5-difluoro-phenylamine Chemical Properties |
| Melting point | 78-79 °C(Solv: ethanol (64-17-5)) | | Boiling point | 236.2±35.0 °C(Predicted) | | density | 1.459±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 1.93±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H4ClF2N/c7-6-4(8)1-3(10)2-5(6)9/h1-2H,10H2 | | InChIKey | LURQZEKPTCFPAE-UHFFFAOYSA-N | | SMILES | C1(N)=CC(F)=C(Cl)C(F)=C1 |
| | 4-Chloro-3,5-difluoro-phenylamine Usage And Synthesis |
| Synthesis Reference(s) | The Journal of Organic Chemistry, 23, p. 1612, 1958 DOI: 10.1021/jo01105a006 |
| | 4-Chloro-3,5-difluoro-phenylamine Preparation Products And Raw materials |
|