|
|
| | 3-methyl-4-trifluoromethylaniline Basic information |
| Product Name: | 3-methyl-4-trifluoromethylaniline | | Synonyms: | 3-methyl-4-trifluoromethylaniline;4-Trifluoromethyl-3-toluidine;3-Methyl-4-trifluoromethyl-phenylamine;3-Methyl-4-(trifluoromethyl) aniline hydrochloride;Benzenamine, 3-methyl-4-(trifluoromethyl)- | | CAS: | 106877-31-0 | | MF: | C8H8F3N | | MW: | 175.15 | | EINECS: | | | Product Categories: | | | Mol File: | 106877-31-0.mol |  |
| | 3-methyl-4-trifluoromethylaniline Chemical Properties |
| storage temp. | 2-8°C, protect from light | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C8H8F3N/c1-5-4-6(12)2-3-7(5)8(9,10)11/h2-4H,12H2,1H3 | | InChIKey | YTMVUFIFISNHDB-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(C(F)(F)F)C(C)=C1 |
| | 3-methyl-4-trifluoromethylaniline Usage And Synthesis |
| Uses | 3-methyl-4-trifluoromethylaniline is a fluoroaniline compound with a trifluoromethyl functional group on the benzene ring. It is widely used in organic synthesis. |
| | 3-methyl-4-trifluoromethylaniline Preparation Products And Raw materials |
|