5-(4-Chlorophenyl)-2-(trifluoromethyl)furan-3-carboxylic acid manufacturers
|
| | 5-(4-Chlorophenyl)-2-(trifluoromethyl)furan-3-carboxylic acid Basic information |
| Product Name: | 5-(4-Chlorophenyl)-2-(trifluoromethyl)furan-3-carboxylic acid | | Synonyms: | 5-(4-CHLOROPHENYL)-2-(TRIFLUOROMETHYL)-3-FUROIC ACID;BUTTPARK 37\08-24;5-(4-Chlorophenyl)-2-(trifluoromethyl)furan-3-carboxylic acid 97%;5-(4-Chlorophenyl)-2-(trifluoromethyl)furan-3-carboxylicacid97%;5-(4-Chlorophenyl)-2-(Trifluoromethyl)Furan-3-Carboxylic;5-(4-Chlorophenyl)-2-(trifluoromethyl)-3-furoic acid 97%;5-(4-Chlorophenyl)-2-(trifluoromethyl)-3-furoicacid97%;5-(4-chlorophenyl)-2-(trifluoromethyl)-3-furancarboxylic acid | | CAS: | 175276-60-5 | | MF: | C12H6ClF3O3 | | MW: | 290.62 | | EINECS: | | | Product Categories: | | | Mol File: | 175276-60-5.mol |  |
| | 5-(4-Chlorophenyl)-2-(trifluoromethyl)furan-3-carboxylic acid Chemical Properties |
| Melting point | 188-190°C | | Boiling point | 400.6±45.0 °C(Predicted) | | density | 1.486±0.06 g/cm3(Predicted) | | pka | 2.85±0.26(Predicted) | | form | solid | | InChI | 1S/C12H6ClF3O3/c13-7-3-1-6(2-4-7)9-5-8(11(17)18)10(19-9)12(14,15)16/h1-5H,(H,17,18) | | InChIKey | BQUIEVOFWHVZAW-UHFFFAOYSA-N | | SMILES | OC(=O)c1cc(oc1C(F)(F)F)-c2ccc(Cl)cc2 | | CAS DataBase Reference | 175276-60-5(CAS DataBase Reference) |
| Hazard Codes | Xi,C,T | | Risk Statements | 36/37/38-34-25 | | Safety Statements | 26-36/37/39-45-22 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2932190090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 5-(4-Chlorophenyl)-2-(trifluoromethyl)furan-3-carboxylic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde |
| | 5-(4-Chlorophenyl)-2-(trifluoromethyl)furan-3-carboxylic acid Preparation Products And Raw materials |
|