|
|
| | CY3 NHS ESTER Basic information |
| Product Name: | CY3 NHS ESTER | | Synonyms: | CY3 NHS ESTER;Cy3-NHS ester(C35H41N3O10S2);Cy3-SE;Cy3-SECy3 NHS Ester;Cyanine3 NHS ester;2-[3-[1-[6-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-6-oxohexyl]-1,3-dihydro-3,3-dimethyl-5-sulfo-2H-indol-2-ylidene]-1-propen-1-yl]-1-ethyl-3,3-dimethyl-5-sulfo-3H-indolium inner salt;Cyanine 3;Sulfo-Cy3-SE | | CAS: | 146368-16-3 | | MF: | C35H41N3O10S2 | | MW: | 727.84 | | EINECS: | | | Product Categories: | FLUOROPHORES;FAM | | Mol File: | 146368-16-3.mol |  |
| | CY3 NHS ESTER Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO: soluble | | form | A crystalline solid | | color | Brown to black | | Appearance | dark red crystals | | InChIKey | SOVMUUCAZOFIQP-UHFFFAOYSA-N | | SMILES | C(N1C(C(C)(C)C2=CC(S(O)(=O)=O)=CC=C12)=CC=CC1C(C2=CC(S([O-])(=O)=O)=CC=C2[N+]=1CC)(C)C)CCCCC(=O)ON1C(CCC1=O)=O |
| | CY3 NHS ESTER Usage And Synthesis |
| Description | Water soluble, amino-reactive sulfo-Cyanine3 NHS ester that efficiently labels proteins and peptides in purely aqueous solution without needing organic co-solvent. Ideal for proteins with low solubility and proteins prone to denaturation.
This is the sulfonated, hydrophilic, and water-soluble dye. Non-sulfonated Cyanine3 NHS ester is also available.
This product is an analog of Cy3® NHS ester. sulfo-Cyanine3 NHS ester replaces Cy3® and DyLight 549 for all applications. | | Uses | Fluorescent dyes are typically used for imaging applications. Cy3 NHS Ester is a fluorescent dye suitable for labeling proteins and nucleic acids. It exhibits excitation and emission at 555 nm and 570 nm, respectively. Cy3 NHS Ester can be used to label functional nucleic acids to detect tertiary structure folding such as guanine quadruplex. | | Chemical Reactivity | Primary amine | | Abs/Em Maxima | 548/563 nm | | Excitation / Emission Maximum | 555 nm/570 nm | | Fluoresene quantum yield | 0.31 | | Extinction Coefficient | 150000 | | CF260 | 0.03 | | CF280 | 0.06 | | Spectrally Similar Dyes | Cy3, DyLight® 555, Alexa Fluor® 555 |
| | CY3 NHS ESTER Preparation Products And Raw materials |
|