|
|
| | (R)-2-Amino-2-(4-fluorophenyl)ethanol Basic information |
| Product Name: | (R)-2-Amino-2-(4-fluorophenyl)ethanol | | Synonyms: | Benzeneethanol, beta-amino-4-fluoro-, (betaR)- (9CI);Benzeneethanol, beta-aMino-4-fluoro-, (betaR)-;(R)-2-AMino-2-(4-fluorophenyl)ethanol;(2R)-2-AMINO-2-(4-FLUOROPHENYL)ETHAN-1-OL;(2R)-2-amino-2-(4-fluorophenyl)ethanol;(R)-2-AMINO-2-(4-FLUOROPHENYL)ETHANOL HCL;(R)-b-AMino-4-fluoro-benzeneethanol;Benzeneethanol, β-amino-4-fluoro-, (βR)- | | CAS: | 174770-74-2 | | MF: | C8H10FNO | | MW: | 155.17 | | EINECS: | | | Product Categories: | HALIDE | | Mol File: | 174770-74-2.mol |  |
| | (R)-2-Amino-2-(4-fluorophenyl)ethanol Chemical Properties |
| Boiling point | 287.4±25.0 °C(Predicted) | | density | 1.208±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 12.48±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | Optical Rotation | Consistent with structure | | InChI | InChI=1/C8H10FNO/c9-7-3-1-6(2-4-7)8(10)5-11/h1-4,8,11H,5,10H2/t8-/s3 | | InChIKey | SRQPEYLZIUEVIA-SBYBRXNCNA-N | | SMILES | C1([C@@H](N)CO)=CC=C(F)C=C1 |&1:1,r| |
| | (R)-2-Amino-2-(4-fluorophenyl)ethanol Usage And Synthesis |
| Chemical Properties | (R)-2-Amino-2-(4-fluorophenyl)ethanol is a white solid. | | Uses | (R)-2-Amino-2-(4-fluorophenyl)ethanol is used for synthesis of organic compounds. | | Hazard | H302: Harmful if swallowed.
H315: Causes skin irritation.
H319: Causes serious eye irritation.
H335: May cause respiratory irritation. | | Synthesis | To a stirred solution of lithium aluminium hydride (1.0 M in THF, 11.9 ml, 11.9 mmol) at 0℃ was added 4- (R)-fluorophenylglycine (1.0 g, 5.9 mmol) portion wise over 1 hour. The mixture was stirred at room temperature for 16 hours. Water (0.45 ml), 4 NNaOH (0.45 ml) and water (1.34 ml) was added to the mixture and the mixture was stirred for 10 minutes before being filtered. The filtrate was concentrated to give a yellow residue, (R)-2-Amino-2-(4-fluorophenyl)ethanol. | | References | [1] Patent: US5952369, 1999, A
[2] Patent: US5998440, 1999, A
[3] Patent: US5854268, 1998, A |
| | (R)-2-Amino-2-(4-fluorophenyl)ethanol Preparation Products And Raw materials |
|