| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | SODIUM L-LACTATE (13C3) Basic information |
| Product Name: | SODIUM L-LACTATE (13C3) | | Synonyms: | Sodium L-lactate-3-13C, 45%-55% aqueous solution;sodium:(2R)-2-hydroxypropanoate;SODIUM L-LACTATE (13C3);SODIUM L-LACTATE-3-13C, SOLUTION IN WATE R, 99 ATOM % 13C;solutioninwater99atom%13c;l-lactic acid-3-13c sodium salt solution;sodium l-lactate-3-13c solution;L-Lactic acid-3-13C solution sodium salt | | CAS: | 201595-70-2 | | MF: | C3H6O3.Na | | MW: | 114.06 | | EINECS: | | | Product Categories: | | | Mol File: | 201595-70-2.mol |  |
| | SODIUM L-LACTATE (13C3) Chemical Properties |
| Melting point | 163-165 °C(lit.) | | refractive index | n20/D 1.42 | | storage temp. | -20°C | | form | liquid | | color | Colorless to light yellow | | InChI | 1S/C3H6O3.Na/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1/t2-;/m0./s1/i1+1; | | InChIKey | NGSFWBMYFKHRBD-UEORGECYSA-M | | SMILES | [Na+].[13CH3][C@H](O)C([O-])=O | | CAS Number Unlabeled | 867-56-1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 1 | | Storage Class | 10 - Combustible liquids |
| | SODIUM L-LACTATE (13C3) Usage And Synthesis |
| Uses | Isotope labelled Sodium L-Lactate is used as a food additive in shampoo products as well as in antiarrythmics. Used to prevent mild to medium metabolic acidosis. |
| | SODIUM L-LACTATE (13C3) Preparation Products And Raw materials |
|