| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Sodium L-lactate-13C3 solution Basic information |
| Product Name: | Sodium L-lactate-13C3 solution | | Synonyms: | SODIUM L-LACTATE-13C3 SOLUTION IN WATE&;SODIUM L-LACTATE-13C3, SOLUTION IN WATER , 99 ATOM % 13C;l-lactic acid-13c3sodium salt solution;sodium l-lactate-13c3solution;L-Lactic acid-13C3 solution sodium salt;Sodium L-lactate-(13-C)3, 45%-55% aqueous solution;sodium:(2S)-2-hydroxypropanoate;SODIUM L-LACTATE (13C3, 98%) | | CAS: | 201595-71-3 | | MF: | C3H6O3.Na | | MW: | 116.05 | | EINECS: | | | Product Categories: | | | Mol File: | 201595-71-3.mol |  |
| | Sodium L-lactate-13C3 solution Chemical Properties |
| Melting point | 163-165 °C(lit.) | | storage temp. | -20°C | | solubility | Aqueous Base (Slightly), Methanol (Sparingly), Water (Soluble) | | form | Colourless Solution | | color | Colorless to light yellow | | InChI | InChI=1/C3H6O3.Na/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1/t2-;/s3/i1+1,2+1,3+1; | | InChIKey | NGSFWBMYFKHRBD-NYUAGJPINA-M | | SMILES | [13C]([O-])(=O)[13C@@H](O)[13CH3].[Na+] |&1:3,r| | | CAS Number Unlabeled | 867-56-1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 1 | | Storage Class | 10 - Combustible liquids |
| | Sodium L-lactate-13C3 solution Usage And Synthesis |
| Uses | SodiumL-lactate-13C3has been used as an internal standard in the quantification of metabolites in murine tumor interstitial fluid using the LC/MS technique. |
| | Sodium L-lactate-13C3 solution Preparation Products And Raw materials |
|