11,13-Hexadecadienal,(11Z,13Z)- manufacturers
|
| | 11,13-Hexadecadienal,(11Z,13Z)- Basic information |
| Product Name: | 11,13-Hexadecadienal,(11Z,13Z)- | | Synonyms: | 11,13-Hexadecadienal,(11Z,13Z)-;Nowtechnicalpheromone;(11Z,13Z)-11,13-Hexadecadienal;(Z,Z)-11,13-Hexadecadienal;11,13-Hexadecadienal, (Z,Z)-;Epa pesticide chemical code 000711;7Z11Z13E-16CHO;11Z13Z-16CHO | | CAS: | 71317-73-2 | | MF: | C16H28O | | MW: | 236.39 | | EINECS: | | | Product Categories: | | | Mol File: | 71317-73-2.mol |  |
| | 11,13-Hexadecadienal,(11Z,13Z)- Chemical Properties |
| Boiling point | 332.7±11.0 °C(Predicted) | | density | 0.852±0.06 g/cm3 (20 ºC 760 Torr) | | refractive index | 1.4768 (589.3 nm 26℃) | | InChI | InChI=1S/C16H28O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17/h3-6,16H,2,7-15H2,1H3/b4-3-,6-5- | | InChIKey | ZTJGMVSDMQAJPE-OUPQRBNQSA-N | | SMILES | C(=O)CCCCCCCCC/C=C\C=C/CC | | LogP | 6.246 (est) | | EPA Substance Registry System | (Z,Z)-11,13-Hexadecadienal (71317-73-2) |
| | 11,13-Hexadecadienal,(11Z,13Z)- Usage And Synthesis |
| | 11,13-Hexadecadienal,(11Z,13Z)- Preparation Products And Raw materials |
|