|
|
| | E,Z-3,13-OCTADECADIENYLACETATE Basic information |
| Product Name: | E,Z-3,13-OCTADECADIENYLACETATE | | Synonyms: | E,Z-3,13-OCTADECADIENYLACETATE;(e,z)-3,13-octadecadien-1-olacetate;acetate,(e,z)-13-octadecadien-1-ol;(3E,13Z)-octadeca-3,13-dienyl acetate;cis,trans-3,13-Octadecadienyl acetate;(3E,13Z)-1-Acetoxy-3,13-octadecadiene;(3E,13Z)-3,13-Octadecadien-1-ol acetate;Acetic acid (3E,13Z)-3,13-octadecadienyl ester | | CAS: | 53120-26-6 | | MF: | C20H36O2 | | MW: | 308.5 | | EINECS: | 258-373-2 | | Product Categories: | | | Mol File: | 53120-26-6.mol |  |
| | E,Z-3,13-OCTADECADIENYLACETATE Chemical Properties |
| Boiling point | 390.3±21.0 °C(Predicted) | | density | 0.882±0.06 g/cm3(Predicted) | | refractive index | 1.4596 (20℃) | | InChI | InChI=1S/C20H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20(2)21/h6-7,16-17H,3-5,8-15,18-19H2,1-2H3/b7-6-,17-16+ | | InChIKey | VVJPJXKHBZNADP-ZSTZHTMOSA-N | | SMILES | C(OC(=O)C)C/C=C/CCCCCCCC/C=C\CCCC | | EPA Substance Registry System | (E,Z)-3,13-Octadecadienyl acetate (53120-26-6) |
| | E,Z-3,13-OCTADECADIENYLACETATE Usage And Synthesis |
| Uses | (3E,13Z)-Octadecadien-1-yl Acetate is a sex pheromone secreted by Synanthedon tenuis. It is produced by the female moth of the Carmenta mimosa. Also, it decreases grape root borer mating in vineyard. | | Definition | ChEBI: 3E,13Z-Octadecadienyl acetate is a carboxylic ester. |
| | E,Z-3,13-OCTADECADIENYLACETATE Preparation Products And Raw materials |
|