| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | Z,Z-3,13-octadecadienylacetate Basic information |
| Product Name: | Z,Z-3,13-octadecadienylacetate | | Synonyms: | (z,z)-3,13-octadecadien-1-olacetate;3,13-octadecadien-1-ol,acetate;acetate,(z,z)-13-octadecadien-1-ol;ai3-36728;exitlure;(3Z,13Z)-octadeca-3,13-dienyl acetate;(Z,Z)-3,13-Octadecadien1-ylacetate;CIS,CIS-3,13-OCTADECADIENYL ACETATE | | CAS: | 53120-27-7 | | MF: | C20H36O2 | | MW: | 308.5 | | EINECS: | 258-374-8 | | Product Categories: | | | Mol File: | 53120-27-7.mol |  |
| | Z,Z-3,13-octadecadienylacetate Chemical Properties |
| InChI | InChI=1S/C20H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20(2)21/h6-7,16-17H,3-5,8-15,18-19H2,1-2H3/b7-6-,17-16- | | InChIKey | VVJPJXKHBZNADP-DNNFRFAMSA-N | | SMILES | C(OC(=O)C)C/C=C\CCCCCCCC/C=C\CCCC | | LogP | 8.273 (est) | | EPA Substance Registry System | (Z,Z)-3,13-Octadecadienyl acetate (53120-27-7) |
| | Z,Z-3,13-octadecadienylacetate Usage And Synthesis |
| Uses | (3Z,13Z)-Octadecadien-1-yl Acetate is a sex pheromone found in Synanthedon Scoliaformis females and it is a known behavioral antagonist against Synanthedon tipuliformis males. | | Definition | ChEBI: 3Z,13Z-Octadecadienyl acetate is a carboxylic ester. | | Safety Profile | Low toxicity by ingestion. Whenheated to decomposition it emits acrid smoke andirritating vapors. |
| | Z,Z-3,13-octadecadienylacetate Preparation Products And Raw materials |
|