- Nudifloric Acid
-
- $29.00
-
2026-08-08
- CAS:3719-45-7
- Purity: 99.55%
- Supply Ability: 10g
|
| | 1-Methyl-6-oxo-1,6-dihydropyridine-3-carboxylic acid Basic information |
| | 1-Methyl-6-oxo-1,6-dihydropyridine-3-carboxylic acid Chemical Properties |
| Melting point | 240-245°C | | Boiling point | 329.6±35.0 °C(Predicted) | | density | 1.381±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Dichloromethane, Methanol | | form | Solid | | pka | 3.85±0.50(Predicted) | | color | White | | InChI | InChI=1S/C7H7NO3/c1-8-4-5(7(10)11)2-3-6(8)9/h2-4H,1H3,(H,10,11) | | InChIKey | RGZCKPXTNJAWMR-UHFFFAOYSA-N | | SMILES | C1N(C)C(=O)C=CC=1C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-Methyl-6-oxo-1,6-dihydropyridine-3-carboxylic acid Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A metabolite of Tryptophan-niacin. |
| | 1-Methyl-6-oxo-1,6-dihydropyridine-3-carboxylic acid Preparation Products And Raw materials |
|