| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
|
| | (S)-2-Phenyl-1-pyrrolidin-1-ylmethyl-ethylamine Basic information |
| Product Name: | (S)-2-Phenyl-1-pyrrolidin-1-ylmethyl-ethylamine | | Synonyms: | (S)-a-benzyl-1-pyrrolidineethanaMine 2HCl;(S)-1-Phenyl-3-(pyrrolidin-1-yl)propan-2-amine;(+)-(S)-2-amino-1-phenyl-3-(pyrrolidin-1-yl)propane;(2S)-1-phenyl-3-pyrrolidin-1-ylpropan-2-amine;1-Pyrrolidineethanamine, α-(phenylmethyl)-, (αS)-;(S)-alpha-(Phenylmethyl)-1-pyrrolidinethanamine;(S)-alpha-(Phenylmethyl)-1-pyrrolidinethanamine 96%;(S)-1-Phenyl-3-(pyrrolidin-1-yl)propan-2-amine dihydrochloride | | CAS: | 200267-75-0 | | MF: | C13H20N2 | | MW: | 204.31 | | EINECS: | | | Product Categories: | | | Mol File: | 200267-75-0.mol |  |
| | (S)-2-Phenyl-1-pyrrolidin-1-ylmethyl-ethylamine Chemical Properties |
| Boiling point | 332.4±30.0 °C(Predicted) | | density | 1.028±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 10.04±0.20(Predicted) | | form | liquid | | Optical Rotation | [α]/D +5.0±1.0°, c = 1 in methanol | | BRN | 10160096 | | InChI | 1S/C13H20N2/c14-13(11-15-8-4-5-9-15)10-12-6-2-1-3-7-12/h1-3,6-7,13H,4-5,8-11,14H2/t13-/m0/s1 | | InChIKey | YDLCAQYNXGDYTM-ZDUSSCGKSA-N | | SMILES | N[C@H](CN1CCCC1)Cc2ccccc2 |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3259PSN1 8 / PGII | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | (S)-2-Phenyl-1-pyrrolidin-1-ylmethyl-ethylamine Usage And Synthesis |
| Uses | (S)-α-(Phenylmethyl)-1-pyrrolidinethanamine can be used as an organocatalyst:
- In the Michael addition reaction of α-substituted vinyl ketones with malononitriles.
- In the aldol reactions of α-hydroxyketones with substituted aldehydes.
- In the asymmetric conjugate addition of vinyl ketones to azoles.
|
| | (S)-2-Phenyl-1-pyrrolidin-1-ylmethyl-ethylamine Preparation Products And Raw materials |
|