| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
|
| | 3H-Imidazo[4,5-b]pyridine, 2-[[4-[4-(2-benzofuranyl)-2-thiazolyl]-1-piperidinyl]methyl]- Basic information |
| | 3H-Imidazo[4,5-b]pyridine, 2-[[4-[4-(2-benzofuranyl)-2-thiazolyl]-1-piperidinyl]methyl]- Chemical Properties |
| Boiling point | 675.2±55.0 °C(Predicted) | | density | 1.367±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 2mg/mL, clear (Warmed) | | pka | 11.38±0.40(Predicted) | | form | Solid | | color | Off-white to light yellow | | InChI | 1S/C23H21N5OS/c1-2-6-19-16(4-1)12-20(29-19)18-14-30-23(26-18)15-7-10-28(11-8-15)13-21-25-17-5-3-9-24-22(17)27-21/h1-6,9,12,14-15H,7-8,10-11,13H2,(H,24,25,27) | | InChIKey | JOCPQSJABURDDD-UHFFFAOYSA-N | | SMILES | C12=C(C=CC=N2)NC(CN3CCC(CC3)C4=NC(C5=CC6=CC=CC=C6O5)=CS4)=N1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3H-Imidazo[4,5-b]pyridine, 2-[[4-[4-(2-benzofuranyl)-2-thiazolyl]-1-piperidinyl]methyl]- Usage And Synthesis |
| Description | BAY-179 is a potent, selective, and species cross-reactive OXPHOS complex I inhibitor. | | Uses | BAY-179 is a potent, selective, and species cross-reactive complex I inhibitor. BAY-179 shows IC50 values of 79 nM, 38 nM, 27 nM, and 47 nM for human, mouse, rat, and dog complex I, respectively[1]. | | References | [1] Mowat J, et al. Identification of the Highly Active, Species Cross-Reactive Complex I Inhibitor BAY-179. ACS Med Chem Lett. 2022;13(3):348-357. Published 2022 Feb 18. DOI:10.1021/acsmedchemlett.1c00666 |
| | 3H-Imidazo[4,5-b]pyridine, 2-[[4-[4-(2-benzofuranyl)-2-thiazolyl]-1-piperidinyl]methyl]- Preparation Products And Raw materials |
|