| Company Name: |
Mainchem Co., Ltd.
|
| Tel: |
+86-0592-6210733 |
| Email: |
sale@mainchem.com |
| Products Intro: |
Product Name:DL-CAMPHORIC ANHYDRIDE CAS:76-32-4
|
| Company Name: |
3B Pharmachem (Wuhan) International Co.,Ltd.
|
| Tel: |
18930552037 |
| Email: |
3bsc@sina.com |
| Products Intro: |
Product Name:DL-CAMPHORIC ANHYDRIDE CAS:76-32-4 Purity:99% HPLC Package:1Mg ; 5Mg;10Mg ;100Mg;250Mg ;500Mg ;1g;2.5g ;5g ;10g
|
DL-CAMPHORIC ANHYDRIDE manufacturers
|
| | DL-CAMPHORIC ANHYDRIDE Basic information |
| Product Name: | DL-CAMPHORIC ANHYDRIDE | | Synonyms: | 1,3-Cyclopentanedicarboxylic anhydride, 1,2,2-trimethyl-;3-Oxabicyclo[3.2.1]octane-2,4-dione, 1,8,8-trimethyl-;3-oxabicyclo[3.2.1]octane-2,4-dione,1,8,8-trimethyl-;3-oxabicyclo[3.2.1]octane-2,4-dione,1,8,8-trimethyl-,(±)-;DL-CAMPHOR ANHYDRIDE;DL-CAMPHORIC ANHYDRIDE;(+/-)-CAMPHORIC ACID ANHYDRIDE;(+/-)-CAMPHORIC ANHYDRIDE | | CAS: | 76-32-4 | | MF: | C10H14O3 | | MW: | 182.22 | | EINECS: | 200-952-9 | | Product Categories: | | | Mol File: | 76-32-4.mol |  |
| | DL-CAMPHORIC ANHYDRIDE Chemical Properties |
| Melting point | 222-225 °C | | Boiling point | 269-271°C | | density | 1.137±0.06 g/cm3(Predicted) | | Fp | 269-271°C | | storage temp. | 2-8°C | | form | solid | | Appearance | White to off-white Solid | | Sensitive | Moisture Sensitive | | BRN | 83114 | | InChI | 1S/C10H14O3/c1-9(2)6-4-5-10(9,3)8(12)13-7(6)11/h6H,4-5H2,1-3H3/t6-,10+/m0/s1 | | InChIKey | VFZDNKRDYPTSTP-QUBYGPBYSA-N | | SMILES | CC1(C)[C@H]2CC[C@]1(C)C(=O)OC2=O | | CAS DataBase Reference | 76-32-4(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | DL-CAMPHORIC ANHYDRIDE Usage And Synthesis |
| Uses | (±)-Camphoric acid anhydride (1,8,8-Trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione) may be useful in the synthesis of aliphatic-aromatic copolyesters. | | Uses | 1,8,8-Trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione could be useful for the syntehsis of aliphatic-aromatic copolyesters, and camphoric acid-based acylhydrazone compounds. | | Purification Methods | Crystallise the anhydride from EtOH. If it contains too much of the acid (by IR), then reflux it in Ac2O, concentrate and collect the crystals, wash them with pet ether and dry them. [Bunton et al J Chem Soc 2918 1963, NMR: Baker & Davis Tetrahedron 24 1663 1968, Beilstein 18 H 400, 401.] |
| | DL-CAMPHORIC ANHYDRIDE Preparation Products And Raw materials |
|