| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
(7,7-Dimethyl-2-oxo-bicyclo[2.2.1]hept-1-yl)-methanesulfonyl chloride manufacturers
|
| | (7,7-Dimethyl-2-oxo-bicyclo[2.2.1]hept-1-yl)-methanesulfonyl chloride Basic information |
| Product Name: | (7,7-Dimethyl-2-oxo-bicyclo[2.2.1]hept-1-yl)-methanesulfonyl chloride | | Synonyms: | 10-CAMPHORSULFONYL CHLORIDE;10-Camphorsulfonyl chloride 98%;(7,7-DIMETHYL-2-OXO-BICYCLO[2.2.1]HEPT-1-YL)-METHANESULFONYL CHLORIDE ISO 9001:2015 REACH;7,7-Dimethyl-2-oxobicyclo[2.2.1]heptane-1-methanesulfonyl Chloride;(7,7-Dimethyl-2-oxo-bicyclo[2.2.1]hept-1-yl)-methanesulfonyl chloride | | CAS: | 4552-50-5 | | MF: | C10H15ClO3S | | MW: | 250.74 | | EINECS: | | | Product Categories: | | | Mol File: | 4552-50-5.mol | ![(7,7-Dimethyl-2-oxo-bicyclo[2.2.1]hept-1-yl)-methanesulfonyl chloride Structure](CAS/GIF/4552-50-5.gif) |
| | (7,7-Dimethyl-2-oxo-bicyclo[2.2.1]hept-1-yl)-methanesulfonyl chloride Chemical Properties |
| Melting point | 66-68 °C (lit.) | | Boiling point | 349.4±15.0 °C(Predicted) | | density | 1.331±0.06 g/cm3 (20 ºC 760 Torr) | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | White to Off-White | | BRN | 3205975 | | InChI | 1S/C10H15ClO3S/c1-9(2)7-3-4-10(9,8(12)5-7)6-15(11,13)14/h7H,3-6H2,1-2H3/t7-,10-/m0/s1 | | InChIKey | BGABKEVTHIJBIW-XVKPBYJWSA-N | | SMILES | CC1(C)[C@H]2CC[C@]1(CS(Cl)(=O)=O)C(=O)C2 | | CAS DataBase Reference | 4552-50-5 |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-28-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | (7,7-Dimethyl-2-oxo-bicyclo[2.2.1]hept-1-yl)-methanesulfonyl chloride Usage And Synthesis |
| Uses | 10-Camphorsulfonyl chloride was used in preparation of 1,2-bis(hydroxycamphorsulfonamido)cyclohexenes and 10-mercaptoisoborneol. |
| | (7,7-Dimethyl-2-oxo-bicyclo[2.2.1]hept-1-yl)-methanesulfonyl chloride Preparation Products And Raw materials |
|