| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | cis-5,8,11-Eicosatrienoic acid methyl ester Basic information |
| Product Name: | cis-5,8,11-Eicosatrienoic acid methyl ester | | Synonyms: | AESHPAQQBZWZMS-NWFXIAEYSA-N;C20:3 (ALL CIS-5,8,11) METHYL ESTER;METHYL 5,8,11-EICOSATRIENOATE;MEAD ACID ME-ESTER;MEAD ACID METHYL ESTER;Methylcis-5,8,11-Eicosatrienoate;5,8,11-Eicosatrienoic acid, methyl ester, (5Z,8Z,11Z)-;cis-5,8,11-Eicosatrienoic acid methyl ester ~10 mg/mL in methanol, >=90% | | CAS: | 14602-39-2 | | MF: | C21H36O2 | | MW: | 320.51 | | EINECS: | 200-659-6 | | Product Categories: | Esters;Methyl Esters;Unsaturated fatty acids and derivatives | | Mol File: | 14602-39-2.mol |  |
| | cis-5,8,11-Eicosatrienoic acid methyl ester Chemical Properties |
| Boiling point | 405.1±34.0 °C(Predicted) | | density | 0.891±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | 0.1 M Na2CO3: 1 mg/ml; DMF: 100 mg/ml; DMSO: 100 mg/ml; Ethanol: 100 mg/ml | | form | Colorless oil. | | InChI | 1S/C21H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23-2/h10-11,13-14,16-17H,3-9,12,15,18-20H2,1-2H3/b11-10-,14-13-,17-16- | | InChIKey | AESHPAQQBZWZMS-NWFXIAEYSA-N | | SMILES | CCCCCCCC\C=C/C\C=C/C\C=C/CCCC(=O)OC |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN 1230 3/PG 2 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | cis-5,8,11-Eicosatrienoic acid methyl ester Usage And Synthesis |
| Description | Mead acid is a 20-carbon ω-9 polyunsaturated fatty acid. Its level is elevated in plasma during essential fatty acid deficiency in humans. 5(Z),8(Z),11(Z)-Eicosatrienoic Acid methyl ester (Mead acid methyl ester) is typically used as a standard for the analysis of fatty acids, when the fatty acids have been transesterified to methyl esters before analysis. | | Uses | Mead acid methyl ester is a kind of biochemical reagent. | | Definition | ChEBI: Cis-5,8,11-Eicosatrienoic acid methyl ester is a fatty acid methyl ester. | | References | [1] Bergmeyer, et al. "Biochemical reagents." Methods of Enzymatic Analysis. Academic Press, 1965. 967-1037. |
| | cis-5,8,11-Eicosatrienoic acid methyl ester Preparation Products And Raw materials |
|