|
|
| | Tris(4-nitrophenyl)amine Basic information |
| | Tris(4-nitrophenyl)amine Chemical Properties |
| Melting point | >300°C | | Boiling point | 594.0±45.0 °C(Predicted) | | density | 1.484±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Very Slightly, Heated, Sonicated, Partially Dissolved) | | form | Solid | | pka | -12.56±0.50(Predicted) | | color | Brown to Very Dark Brown | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | InChI=1S/C18H12N4O6/c23-20(24)16-7-1-13(2-8-16)19(14-3-9-17(10-4-14)21(25)26)15-5-11-18(12-6-15)22(27)28/h1-12H | | InChIKey | LSNJBIDKQIRWRQ-UHFFFAOYSA-N | | SMILES | C1(N(C2=CC=C([N+]([O-])=O)C=C2)C2=CC=C([N+]([O-])=O)C=C2)=CC=C([N+]([O-])=O)C=C1 | | CAS DataBase Reference | 20440-93-1(CAS DataBase Reference) | | EPA Substance Registry System | Benzenamine, 4-nitro-N,N-bis(4-nitrophenyl)- (20440-93-1) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2921490090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Tris(4-nitrophenyl)amine Usage And Synthesis |
| Chemical Properties | Brown Solid | | Uses | Tris(p-nitrophenyl)amine (cas# 20440-93-1) is a compound useful in organic synthesis. Dyes and metabolites. | | Synthesis | Tris(4-nitrophenyl)amine can be prepared from p-nitroaniline and 4-chloronitrobenzene or p-nitrofluorobenzene as raw materials. |
| | Tris(4-nitrophenyl)amine Preparation Products And Raw materials |
|