- TAPA
-
- $0.00 / 1KG
-
2026-03-20
- CAS:5981-09-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 mt
|
| Product Name: | TAPA | | Synonyms: | TAPA;TRIS(P-AMINOPHENYL)AMINE;N,N-bis(4-aminophenyl)benzene-1,4-diamine;Tris(4-aminophenyl)amine;N1,N1-Bis(4-aminophenyl)-1,4-benzenediamine;4,4',4''-Nitrilotrianiline;4,4',4''-Nitrilotris(aniline);4,4',4''-Nitrilotris(benzenamine) | | CAS: | 5981-09-9 | | MF: | C18H18N4 | | MW: | 290.36 | | EINECS: | 227-791-7 | | Product Categories: | COF;Fluorescent Labels and Indicators;Fluorescent Labels & Indicators | | Mol File: | 5981-09-9.mol |  |
| Melting point | 230 °C | | Boiling point | 571.3±45.0 °C(Predicted) | | density | 1.276±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in DMSO, DMF, Insoluble in methanol & water | | pka | 7.03±0.10(Predicted) | | form | Solid | | color | Grey coloured crystalline powder | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C18H18N4/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h1-12H,19-21H2 | | InChIKey | SNLFYGIUTYKKOE-UHFFFAOYSA-N | | SMILES | C1(N(C2=CC=C(N)C=C2)C2=CC=C(N)C=C2)=CC=C(N)C=C1 | | CAS DataBase Reference | 5981-09-9 | | EPA Substance Registry System | 1,4-Benzenediamine, N,N-bis(4-aminophenyl)- (5981-09-9) |
| TSCA | TSCA listed | | HS Code | 29215900 |
| Chemical Properties | Yellow Crystalline Solid | | Uses | A fluorescent trifunctional highly symmetric probe. Shows remarkably high nonlinear optical properties. |
| | TAPA Preparation Products And Raw materials |
|