|
|
| | Zolmitriptan N-Oxide Basic information |
| | Zolmitriptan N-Oxide Chemical Properties |
| Melting point | >185°C (dec.) | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 12.55±0.40(Predicted) | | color | White | | Major Application | pharmaceutical | | InChI | 1S/C16H21N3O3/c1-19(2,21)6-5-12-9-17-15-4-3-11(8-14(12)15)7-13-10-22-16(20)18-13/h3-4,8-9,13,17H,5-7,10H2,1-2H3,(H,18,20) | | InChIKey | GZYCQRZFJIZOKU-UHFFFAOYSA-N | | SMILES | [N](=O)(CCc1c2c([nH]c1)ccc(c2)CC3NC(=O)OC3)(C)C | | CAS DataBase Reference | 251451-30-6 |
| WGK Germany | WGK 3 | | HS Code | 2934990002 | | Storage Class | 11 - Combustible Solids |
| | Zolmitriptan N-Oxide Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A metabolite of Zolmitriptan. Zolmitriptan USP Related Compound E. |
| | Zolmitriptan N-Oxide Preparation Products And Raw materials |
|