|
|
| | Zolmitriptan Related Compound B (20 mg) ((S)-2-Amino-3-{3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}propan-1-ol) Basic information |
| | Zolmitriptan Related Compound B (20 mg) ((S)-2-Amino-3-{3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}propan-1-ol) Chemical Properties |
| Boiling point | 480.153±45.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.157±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 15-25°C | | pka | 12.752±0.10(predicted) | | Major Application | pharmaceutical | | InChI | 1S/C15H23N3O/c1-18(2)6-5-12-9-17-15-4-3-11(8-14(12)15)7-13(16)10-19/h3-4,8-9,13,17,19H,5-7,10,16H2,1-2H3/t13-/m0/s1 | | InChIKey | XYSYRJCYRKMOFP-ZDUSSCGKSA-N | | SMILES | [nH]1c2c(c(c1)CCN(C)C)cc(cc2)C[C@H](N)CO |
| WGK Germany | WGK 3 | | HS Code | 2934990002 | | Storage Class | 11 - Combustible Solids |
| | Zolmitriptan Related Compound B (20 mg) ((S)-2-Amino-3-{3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}propan-1-ol) Usage And Synthesis |
| Uses | (S)-β-Amino-3-[2-(dimethylamino)ethyl]-1H-indole-5-propanol, is a compound related to Zolmitriptan (Z639000), which is Serotonin 5HTID-receptor agonist. |
| | Zolmitriptan Related Compound B (20 mg) ((S)-2-Amino-3-{3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}propan-1-ol) Preparation Products And Raw materials |
|