| Company Name: |
Daicel Chiral Technologies (China)CO.,LTD
|
| Tel: |
021-50460086-9 15921403865 |
| Email: |
han_yajun@dctc.daicel.com |
| Products Intro: |
Product Name:PRIMAQUINE PHOSPHATE IMPURITY
Purity:95%HPLC Package:10MG;25MG;50MG;100MG Remarks:DCTI-C-2830
|
| Company Name: |
Shenzhen SUNGENING Bio-Medical Co., Ltd.
|
| Tel: |
0755-28967200 13631290199 |
| Email: |
wxf@sungening.com |
| Products Intro: |
Product Name:Primaquine Related Compound A
CAS:525-61-1
Purity:99% HPLC or More Package:10MG;25MG;50MG;100MG
|
Quinocide manufacturers
- Quinocide
-
- $2.00
-
2026-04-17
- CAS:525-61-1
- Purity: 99%
|
| | Quinocide Basic information |
| Product Name: | Quinocide | | Synonyms: | 8-[(4-Aminopentyl)amino]-6-methoxyquinoline;Khinocyde;N-(6-Methoxy-8-quinolinyl)-1,4-pentanediamine;1-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;4-aminopentyl-(6-methoxy-8-quinolyl)amine;N1-(6-Methoxy-8-quinolinyl)-1,4-pentanediamine;PriMaquine Related CoMpound A;Quinocide | | CAS: | 525-61-1 | | MF: | C15H21N3O | | MW: | 259.35 | | EINECS: | | | Product Categories: | | | Mol File: | 525-61-1.mol |  |
| | Quinocide Chemical Properties |
| Melting point | 46° | | Boiling point | bp1 183-186° | | density | 1.126±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 10.73±0.35(Predicted) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C15H21N3O/c1-11(16)5-3-7-17-14-10-13(19-2)9-12-6-4-8-18-15(12)14/h4,6,8-11,17H,3,5,7,16H2,1-2H3 | | InChIKey | NBAFIBBHADOTMU-UHFFFAOYSA-N | | SMILES | N(CCCC(N)C)c1c2ncccc2cc(c1)OC |
| RIDADR | UN 1544PSN1 6.1 / PGIII | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933497050 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | Quinocide Usage And Synthesis |
| Uses | Quinocide is an impurity of Primaquine (P733505). Primaquine is an important antimalarial drug. |
| | Quinocide Preparation Products And Raw materials |
|