| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | Tridecanoic-2,2-d2 acid Basic information |
| | Tridecanoic-2,2-d2 acid Chemical Properties |
| Melting point | 41-42 °C(lit.) | | Boiling point | 236 °C/100 mmHg | | Fp | 113 °C | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C13H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h2-12H2,1H3,(H,14,15)/i12D2 | | InChIKey | SZHOJFHSIKHZHA-XUWBISKJSA-N | | SMILES | C([2H])([2H])(C(=O)O)CCCCCCCCCCC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Tridecanoic-2,2-d2 acid Usage And Synthesis |
| Uses | Tridecanoic-2,2-d2 Acid (CAS# 64118-44-1) is a useful isotopically labeled research compound. |
| | Tridecanoic-2,2-d2 acid Preparation Products And Raw materials |
|