| Company Name: |
Shanghai Saikerui Biotechnology Co. , Ltd. Gold
|
| Tel: |
021-58000709 13120558703 |
| Email: |
sales@scrbio.com |
| Products Intro: |
Product Name:D2]-Tridecanoic Acid
CAS:64118-44-1
Purity:98% Package:1mg;5mg;10mg
|
| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Tridecanoic-d2 Acid
CAS:64118-44-1
Remarks:CS-C-00726
|
| Company Name: |
Nanjing Haolv Biotechnology Co.,Ltd
|
| Tel: |
025-84622273 17361806303 |
| Email: |
kexin.zhou@haolvbiotech.com |
| Products Intro: |
Product Name:Tridecanoic-2,2-d2 Acid
CAS:64118-44-1
Purity:98% Package:5g;25g;100g Remarks:Fatty Acids and Fatty Acid Esters
|
|
| | TRIDECANOIC-2,2-D2 ACID Basic information |
| | TRIDECANOIC-2,2-D2 ACID Chemical Properties |
| Melting point | 41-42 °C(lit.) | | Boiling point | 236 °C/100 mmHg | | Fp | 113 °C | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C13H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h2-12H2,1H3,(H,14,15)/i12D2 | | InChIKey | SZHOJFHSIKHZHA-XUWBISKJSA-N | | SMILES | C([2H])([2H])(C(=O)O)CCCCCCCCCCC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | TRIDECANOIC-2,2-D2 ACID Usage And Synthesis |
| Uses | Tridecanoic-2,2-d2 Acid (CAS# 64118-44-1) is a useful isotopically labeled research compound. |
| | TRIDECANOIC-2,2-D2 ACID Preparation Products And Raw materials |
|