| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | OCTADECANOIC-D35 ACID Basic information |
| Product Name: | OCTADECANOIC-D35 ACID | | Synonyms: | STEARIC ACID (D35);OCTADECANOIC-D35 ACID;Octadecanoic-d35 Acid,98 atom % D;STEARIC-D35 ACID, 98 ATOM % D;OCTADECANOIC-D ACID;Stearic-d35 acid,Octadecanoic-d35 acid;Stearic-d35 acid 98 atom % D, 99% (CP);Stearic-D35 AcidQ: What is
Stearic-D35 Acid Q: What is the CAS Number of
Stearic-D35 Acid | | CAS: | 17660-51-4 | | MF: | C18H36O2 | | MW: | 284.48 | | EINECS: | | | Product Categories: | | | Mol File: | 17660-51-4.mol |  |
| | OCTADECANOIC-D35 ACID Chemical Properties |
| Melting point | 68-70 °C(lit.) | | Boiling point | 361 °C(lit.) | | Fp | 113℃ | | storage temp. | Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20) | | InChIKey | QIQXTHQIDYTFRH-UHFFFAOYSA-N | | CAS Number Unlabeled | 57-11-4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | OCTADECANOIC-D35 ACID Usage And Synthesis |
| Uses | Stearic-D35 Acid is used for preparation of deuterated octadecanethiols. Stearic-D35 Acid is an isotope labeled analog of Stearic Acid (S686495), which is used in the synthesis of surfactants and detergents due to the fatty acid component of its structure. |
| | OCTADECANOIC-D35 ACID Preparation Products And Raw materials |
|