|
|
| | Silane, methoxydimethylphenyl- Basic information |
| Product Name: | Silane, methoxydimethylphenyl- | | Synonyms: | Dimethylmethoxyphenylsilane;Phenyl(methoxy)dimethylsilane;Phenyldimethyl(methoxy)silane;Dimethylphenylmethoxysilane;Silane, methoxydimethylphenyl-;methoxy-dimethyl-phenyl-silane;Benzene, (methoxydimethylsilyl)-;DK123 | | CAS: | 17881-88-8 | | MF: | C9H14OSi | | MW: | 166.29 | | EINECS: | | | Product Categories: | | | Mol File: | 17881-88-8.mol |  |
| | Silane, methoxydimethylphenyl- Chemical Properties |
| Boiling point | 82°C/28mm | | refractive index | 1.4850 to 1.4890 | | Fp | 82°C/28mm | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C9H14OSi/c1-10-11(2,3)9-7-5-4-6-8-9/h4-8H,1-3H3 | | InChIKey | REQXNMOSXYEQLM-UHFFFAOYSA-N | | SMILES | C1([Si](OC)(C)C)=CC=CC=C1 | | CAS DataBase Reference | 17881-88-8 |
| Risk Statements | 36/38 | | Safety Statements | 26-37 | | RIDADR | UN 1993 3/PG III | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29319090 |
| | Silane, methoxydimethylphenyl- Usage And Synthesis |
| | Silane, methoxydimethylphenyl- Preparation Products And Raw materials |
|