| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 6-O-(tert-Butyldiphenylsilyl)-D-galactal cyclic carbonate Basic information |
| | 6-O-(tert-Butyldiphenylsilyl)-D-galactal cyclic carbonate Chemical Properties |
| Melting point | -3 °C (lit.) | | Boiling point | 521.5±50.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | Optical Rotation | [α]20/D 40.0°, c = 1 in chloroform | | InChI | 1S/C23H28O7Si/c1-23(2,3)31(16-10-6-4-7-11-16,17-12-8-5-9-13-17)28-15-18(25)21-20(26)19(14-24)29-22(27)30-21/h4-14,18-21,25-26H,15H2,1-3H3/t18-,19-,20-,21+/m1/s1 | | InChIKey | OXQFQHKHZPNZSN-NCYKPQTJSA-N | | SMILES | CC(C)(C)[Si](OC[C@@H](O)[C@@H]1OC(=O)O[C@H](C=O)[C@H]1O)(c2ccccc2)c3ccccc3 |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | 6-O-(tert-Butyldiphenylsilyl)-D-galactal cyclic carbonate Usage And Synthesis |
| Uses | Important building block for both solution- and solid-phase synthesis of oligosaccharides.1 |
| | 6-O-(tert-Butyldiphenylsilyl)-D-galactal cyclic carbonate Preparation Products And Raw materials |
|