| Company Name: |
Shanghai Chiral Chemistry Co.,Ltd Gold
|
| Tel: |
021-34621844 17301717660 |
| Email: |
404352994@qq.com |
| Products Intro: |
Product Name:1-(4-methoxyphenyl)propan-2-ol
CAS:30314-64-8
Purity:97% Package:1kg
|
| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:1-(4-methoxyphenyl)propan-2-ol
CAS:30314-64-8
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Changzhou Hopschain Chemical Co.,Ltd.
|
| Tel: |
85528066 13775048983 |
| Email: |
sales@hopschem.com |
| Products Intro: |
Product Name:1-(4-methoxyphenyl)propan-2-ol
CAS:30314-64-8
Purity:95+% Package:100mg;250mg;500mg;1g;2.5g;5g;10g
|
1-(4-methoxyphenyl)propan-2-ol manufacturers
|
| | 1-(4-methoxyphenyl)propan-2-ol Basic information |
| | 1-(4-methoxyphenyl)propan-2-ol Chemical Properties |
| Boiling point | 107-110 °C(Press: 1 Torr) | | density | 1.034±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | pka | 15.08±0.26(Predicted) | | color | Colourless | | InChI | InChI=1S/C10H14O2/c1-8(11)7-9-3-5-10(12-2)6-4-9/h3-6,8,11H,7H2,1-2H3 | | InChIKey | TXIWFQCAXKAOBZ-UHFFFAOYSA-N | | SMILES | C1(CC(O)C)=CC=C(OC)C=C1 |
| | 1-(4-methoxyphenyl)propan-2-ol Usage And Synthesis |
| Uses | 1-(p-Methoxyphenyl)-2-propanol is an intermediate in the synthesis of analogues of CNS stimulant, Amphetamine (A634248). |
| | 1-(4-methoxyphenyl)propan-2-ol Preparation Products And Raw materials |
|