|
|
| | 4-Methoxybenzoin Basic information |
| Product Name: | 4-Methoxybenzoin | | Synonyms: | BENZANISOIN;Hydroxy(phenyl)methyl 4-methoxyphenyl ketone;NSC 26659;NSC 57856;2-Hydroxy-1-(4-methoxyphenyl)-2-phenylethanone;Ethanone, 2-hydroxy-1-(4-methoxyphenyl)-2-phenyl-;4-((2-bromo-[1,1-bipheny1]-3-y1)methoxy)-5-ch1oro-2-hydroxybenza1dehyde;4-Methoxybenzoin | | CAS: | 4254-17-5 | | MF: | C15H14O3 | | MW: | 242.27 | | EINECS: | | | Product Categories: | Aromatic Ketones (substituted) | | Mol File: | Mol File |  |
| | 4-Methoxybenzoin Chemical Properties |
| Melting point | 108 °C | | Boiling point | 421.0±30.0 °C(Predicted) | | density | 1.188±0.06 g/cm3(Predicted) | | pka | 12.07±0.20(Predicted) | | InChI | InChI=1S/C15H14O3/c1-18-13-9-7-12(8-10-13)15(17)14(16)11-5-3-2-4-6-11/h2-10,14,16H,1H3 | | InChIKey | PVSFIFPJPUEHPO-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(OC)C=C1)C(O)C1=CC=CC=C1 |
| | 4-Methoxybenzoin Usage And Synthesis |
| Uses | 4-Methoxybenzoin is used in preparation of Benzofuran-2-one compounds useful for the treatment of cancer. |
| | 4-Methoxybenzoin Preparation Products And Raw materials |
|